diff --git a/.coveralls.yml b/.coveralls.yml
new file mode 100644
index 0000000000000000000000000000000000000000..a8172feb1d56d24d6a59e59e27ce75ccb5008be8
--- /dev/null
+++ b/.coveralls.yml
@@ -0,0 +1 @@
+json_path: coveralls-upload.json
diff --git a/.travis.yml b/.travis.yml
new file mode 100644
index 0000000000000000000000000000000000000000..2f34eb2402c7211066e2401b7e4cb11d3e5f4369
--- /dev/null
+++ b/.travis.yml
@@ -0,0 +1,25 @@
+language: php
+
+dist: trusty
+
+matrix:
+ include:
+ - php: 7.2
+ - php: 7.3
+ - php: 7.4
+ env: ANALYSIS='true'
+ - php: nightly
+
+ allow_failures:
+ - php: nightly
+
+before_script:
+- composer require php-coveralls/php-coveralls:^2.2.0
+- composer install -n
+
+script:
+- if [[ "$ANALYSIS" == 'true' ]]; then vendor/bin/phpunit --coverage-clover clover.xml ; fi
+- if [[ "$ANALYSIS" == 'true' ]]; then vendor/bin/phpstan analyse src ; fi
+
+after_success:
+- if [[ "$ANALYSIS" == 'true' ]]; then vendor/bin/php-coveralls --coverage_clover=clover.xml -v ; fi
diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md
new file mode 100644
index 0000000000000000000000000000000000000000..1c7a3e3dd3d42b18299d733aff096175f016f60a
--- /dev/null
+++ b/CONTRIBUTING.md
@@ -0,0 +1,14 @@
+# How to Contribute
+
+## Pull Requests
+
+1. Fork the Slim Skeleton repository
+2. Create a new branch for each feature or improvement
+3. Send a pull request from each feature branch to the **4.x** branch
+
+It is very important to separate new features or improvements into separate feature branches, and to send a
+pull request for each branch. This allows us to review and pull in new features or improvements individually.
+
+## Style Guide
+
+All pull requests must adhere to the [PSR-2 standard](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-2-coding-style-guide.md).
diff --git a/README.md b/README.md
index f535d3f98df67625ca4d5718c8818d065ab46c53..5d238f6fbab9f9b7df49f33ec38a2f7ba7bc418c 100644
--- a/README.md
+++ b/README.md
@@ -1,2 +1,42 @@
-# project-covid
+# Slim Framework 4 Skeleton Application
+[](https://coveralls.io/github/slimphp/Slim-Skeleton?branch=master)
+
+Use this skeleton application to quickly setup and start working on a new Slim Framework 4 application. This application uses the latest Slim 4 with Slim PSR-7 implementation and PHP-DI container implementation. It also uses the Monolog logger.
+
+This skeleton application was built for Composer. This makes setting up a new Slim Framework application quick and easy.
+
+## Install the Application
+
+Run this command from the directory in which you want to install your new Slim Framework application.
+
+```bash
+composer create-project slim/slim-skeleton [my-app-name]
+```
+
+Replace `[my-app-name]` with the desired directory name for your new application. You'll want to:
+
+* Point your virtual host document root to your new application's `public/` directory.
+* Ensure `logs/` is web writable.
+
+To run the application in development, you can run these commands
+
+```bash
+cd [my-app-name]
+composer start
+```
+
+Or you can use `docker-compose` to run the app with `docker`, so you can run these commands:
+```bash
+cd [my-app-name]
+docker-compose up -d
+```
+After that, open `http://localhost:8080` in your browser.
+
+Run this command in the application directory to run the test suite
+
+```bash
+composer test
+```
+
+That's it! Now go build something cool.
diff --git a/app/dependencies.php b/app/dependencies.php
new file mode 100644
index 0000000000000000000000000000000000000000..1ff8d29256dbd3f4ba3a41e3637a9910c2e8ab0a
--- /dev/null
+++ b/app/dependencies.php
@@ -0,0 +1,28 @@
+<?php
+declare(strict_types=1);
+
+use DI\ContainerBuilder;
+use Monolog\Handler\StreamHandler;
+use Monolog\Logger;
+use Monolog\Processor\UidProcessor;
+use Psr\Container\ContainerInterface;
+use Psr\Log\LoggerInterface;
+
+return function (ContainerBuilder $containerBuilder) {
+ $containerBuilder->addDefinitions([
+ LoggerInterface::class => function (ContainerInterface $c) {
+ $settings = $c->get('settings');
+
+ $loggerSettings = $settings['logger'];
+ $logger = new Logger($loggerSettings['name']);
+
+ $processor = new UidProcessor();
+ $logger->pushProcessor($processor);
+
+ $handler = new StreamHandler($loggerSettings['path'], $loggerSettings['level']);
+ $logger->pushHandler($handler);
+
+ return $logger;
+ },
+ ]);
+};
diff --git a/app/middleware.php b/app/middleware.php
new file mode 100644
index 0000000000000000000000000000000000000000..20c89809f8412a569689c66361875f362b8c9692
--- /dev/null
+++ b/app/middleware.php
@@ -0,0 +1,9 @@
+<?php
+declare(strict_types=1);
+
+use App\Application\Middleware\SessionMiddleware;
+use Slim\App;
+
+return function (App $app) {
+ $app->add(SessionMiddleware::class);
+};
diff --git a/app/repositories.php b/app/repositories.php
new file mode 100644
index 0000000000000000000000000000000000000000..62a58f3e20c20457276b182eece699e46c548636
--- /dev/null
+++ b/app/repositories.php
@@ -0,0 +1,13 @@
+<?php
+declare(strict_types=1);
+
+use App\Domain\User\UserRepository;
+use App\Infrastructure\Persistence\User\InMemoryUserRepository;
+use DI\ContainerBuilder;
+
+return function (ContainerBuilder $containerBuilder) {
+ // Here we map our UserRepository interface to its in memory implementation
+ $containerBuilder->addDefinitions([
+ UserRepository::class => \DI\autowire(InMemoryUserRepository::class),
+ ]);
+};
diff --git a/app/routes.php b/app/routes.php
new file mode 100644
index 0000000000000000000000000000000000000000..d4a2fffdd54b37822de6e0d747bc37ba7fc19bca
--- /dev/null
+++ b/app/routes.php
@@ -0,0 +1,26 @@
+<?php
+declare(strict_types=1);
+
+use App\Application\Actions\User\ListUsersAction;
+use App\Application\Actions\User\ViewUserAction;
+use Psr\Http\Message\ResponseInterface as Response;
+use Psr\Http\Message\ServerRequestInterface as Request;
+use Slim\App;
+use Slim\Interfaces\RouteCollectorProxyInterface as Group;
+
+return function (App $app) {
+ $app->options('/{routes:.*}', function (Request $request, Response $response) {
+ // CORS Pre-Flight OPTIONS Request Handler
+ return $response;
+ });
+
+ $app->get('/', function (Request $request, Response $response) {
+ $response->getBody()->write('Hello world!');
+ return $response;
+ });
+
+ $app->group('/users', function (Group $group) {
+ $group->get('', ListUsersAction::class);
+ $group->get('/{id}', ViewUserAction::class);
+ });
+};
diff --git a/app/settings.php b/app/settings.php
new file mode 100644
index 0000000000000000000000000000000000000000..9db7ad118c96eb7924a43bce9fe7b19c8dfc3966
--- /dev/null
+++ b/app/settings.php
@@ -0,0 +1,19 @@
+<?php
+declare(strict_types=1);
+
+use DI\ContainerBuilder;
+use Monolog\Logger;
+
+return function (ContainerBuilder $containerBuilder) {
+ // Global Settings Object
+ $containerBuilder->addDefinitions([
+ 'settings' => [
+ 'displayErrorDetails' => true, // Should be set to false in production
+ 'logger' => [
+ 'name' => 'slim-app',
+ 'path' => isset($_ENV['docker']) ? 'php://stdout' : __DIR__ . '/../logs/app.log',
+ 'level' => Logger::DEBUG,
+ ],
+ ],
+ ]);
+};
diff --git a/composer.json b/composer.json
new file mode 100644
index 0000000000000000000000000000000000000000..00d20764b77391e20c38ea5c15cb89f29c7f6610
--- /dev/null
+++ b/composer.json
@@ -0,0 +1,56 @@
+{
+ "name": "slim/slim-skeleton",
+ "description": "A Slim Framework skeleton application for rapid development",
+ "keywords": [
+ "microframework",
+ "rest",
+ "router",
+ "psr7"
+ ],
+ "homepage": "http://github.com/slimphp/Slim-Skeleton",
+ "license": "MIT",
+ "authors": [
+ {
+ "name": "Josh Lockhart",
+ "email": "info@joshlockhart.com",
+ "homepage": "http://www.joshlockhart.com/"
+ },
+ {
+ "name": "Pierre Berube",
+ "email": "pierre@lgse.com",
+ "homepage": "http://www.lgse.com/"
+ }
+ ],
+ "require": {
+ "php": "^7.2",
+ "ext-json": "*",
+ "monolog/monolog": "^2.1",
+ "php-di/php-di": "^6.2",
+ "slim/psr7": "^1.1",
+ "slim/slim": "^4.5"
+ },
+ "require-dev": {
+ "jangregor/phpstan-prophecy": "^0.8.0",
+ "phpstan/extension-installer": "^1.0.4",
+ "phpstan/phpstan": "^0.12.37",
+ "phpunit/phpunit": "^8.5"
+ },
+ "config": {
+ "process-timeout": 0,
+ "sort-packages": true
+ },
+ "autoload": {
+ "psr-4": {
+ "App\\": "src/"
+ }
+ },
+ "autoload-dev": {
+ "psr-4": {
+ "Tests\\": "tests/"
+ }
+ },
+ "scripts": {
+ "start": "php -S localhost:8080 -t public",
+ "test": "phpunit"
+ }
+}
diff --git a/composer.lock b/composer.lock
new file mode 100644
index 0000000000000000000000000000000000000000..ff6431a67beda497ace56b95b46184519a71e8d4
--- /dev/null
+++ b/composer.lock
@@ -0,0 +1,2686 @@
+{
+ "_readme": [
+ "This file locks the dependencies of your project to a known state",
+ "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies",
+ "This file is @generated automatically"
+ ],
+ "content-hash": "2e2028ef90191ac3ecc1aa6e8436de9e",
+ "packages": [
+ {
+ "name": "fig/http-message-util",
+ "version": "1.1.4",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/http-message-util.git",
+ "reference": "3242caa9da7221a304b8f84eb9eaddae0a7cf422"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/http-message-util/zipball/3242caa9da7221a304b8f84eb9eaddae0a7cf422",
+ "reference": "3242caa9da7221a304b8f84eb9eaddae0a7cf422",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^5.3 || ^7.0"
+ },
+ "suggest": {
+ "psr/http-message": "The package containing the PSR-7 interfaces"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.1.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Fig\\Http\\Message\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "description": "Utility classes and constants for use with PSR-7 (psr/http-message)",
+ "keywords": [
+ "http",
+ "http-message",
+ "psr",
+ "psr-7",
+ "request",
+ "response"
+ ],
+ "time": "2020-02-05T20:36:27+00:00"
+ },
+ {
+ "name": "monolog/monolog",
+ "version": "2.1.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/Seldaek/monolog.git",
+ "reference": "f9eee5cec93dfb313a38b6b288741e84e53f02d5"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/Seldaek/monolog/zipball/f9eee5cec93dfb313a38b6b288741e84e53f02d5",
+ "reference": "f9eee5cec93dfb313a38b6b288741e84e53f02d5",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.2",
+ "psr/log": "^1.0.1"
+ },
+ "provide": {
+ "psr/log-implementation": "1.0.0"
+ },
+ "require-dev": {
+ "aws/aws-sdk-php": "^2.4.9 || ^3.0",
+ "doctrine/couchdb": "~1.0@dev",
+ "elasticsearch/elasticsearch": "^6.0",
+ "graylog2/gelf-php": "^1.4.2",
+ "php-amqplib/php-amqplib": "~2.4",
+ "php-console/php-console": "^3.1.3",
+ "php-parallel-lint/php-parallel-lint": "^1.0",
+ "phpspec/prophecy": "^1.6.1",
+ "phpunit/phpunit": "^8.5",
+ "predis/predis": "^1.1",
+ "rollbar/rollbar": "^1.3",
+ "ruflin/elastica": ">=0.90 <3.0",
+ "swiftmailer/swiftmailer": "^5.3|^6.0"
+ },
+ "suggest": {
+ "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB",
+ "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+ "elasticsearch/elasticsearch": "Allow sending log messages to an Elasticsearch server via official client",
+ "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+ "ext-mbstring": "Allow to work properly with unicode symbols",
+ "ext-mongodb": "Allow sending log messages to a MongoDB server (via driver)",
+ "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server",
+ "mongodb/mongodb": "Allow sending log messages to a MongoDB server (via library)",
+ "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib",
+ "php-console/php-console": "Allow sending log messages to Google Chrome",
+ "rollbar/rollbar": "Allow sending log messages to Rollbar",
+ "ruflin/elastica": "Allow sending log messages to an Elastic Search server"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Monolog\\": "src/Monolog"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Jordi Boggiano",
+ "email": "j.boggiano@seld.be",
+ "homepage": "http://seld.be"
+ }
+ ],
+ "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+ "homepage": "http://github.com/Seldaek/monolog",
+ "keywords": [
+ "log",
+ "logging",
+ "psr-3"
+ ],
+ "funding": [
+ {
+ "url": "https://github.com/Seldaek",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/monolog/monolog",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2020-07-23T08:41:23+00:00"
+ },
+ {
+ "name": "nikic/fast-route",
+ "version": "v1.3.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/nikic/FastRoute.git",
+ "reference": "181d480e08d9476e61381e04a71b34dc0432e812"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/nikic/FastRoute/zipball/181d480e08d9476e61381e04a71b34dc0432e812",
+ "reference": "181d480e08d9476e61381e04a71b34dc0432e812",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.4.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^4.8.35|~5.7"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "FastRoute\\": "src/"
+ },
+ "files": [
+ "src/functions.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Nikita Popov",
+ "email": "nikic@php.net"
+ }
+ ],
+ "description": "Fast request router for PHP",
+ "keywords": [
+ "router",
+ "routing"
+ ],
+ "time": "2018-02-13T20:26:39+00:00"
+ },
+ {
+ "name": "opis/closure",
+ "version": "3.5.7",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/opis/closure.git",
+ "reference": "4531e53afe2fc660403e76fb7644e95998bff7bf"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/opis/closure/zipball/4531e53afe2fc660403e76fb7644e95998bff7bf",
+ "reference": "4531e53afe2fc660403e76fb7644e95998bff7bf",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^5.4 || ^7.0"
+ },
+ "require-dev": {
+ "jeremeamia/superclosure": "^2.0",
+ "phpunit/phpunit": "^4.0 || ^5.0 || ^6.0 || ^7.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.5.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Opis\\Closure\\": "src/"
+ },
+ "files": [
+ "functions.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Marius Sarca",
+ "email": "marius.sarca@gmail.com"
+ },
+ {
+ "name": "Sorin Sarca",
+ "email": "sarca_sorin@hotmail.com"
+ }
+ ],
+ "description": "A library that can be used to serialize closures (anonymous functions) and arbitrary objects.",
+ "homepage": "https://opis.io/closure",
+ "keywords": [
+ "anonymous functions",
+ "closure",
+ "function",
+ "serializable",
+ "serialization",
+ "serialize"
+ ],
+ "time": "2020-09-06T17:02:15+00:00"
+ },
+ {
+ "name": "php-di/invoker",
+ "version": "2.1.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/PHP-DI/Invoker.git",
+ "reference": "6a6f8f276d2680e77d06294b9fd67b4881b1f82d"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/PHP-DI/Invoker/zipball/6a6f8f276d2680e77d06294b9fd67b4881b1f82d",
+ "reference": "6a6f8f276d2680e77d06294b9fd67b4881b1f82d",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.3",
+ "psr/container": "~1.0"
+ },
+ "require-dev": {
+ "athletic/athletic": "~0.1.8",
+ "phpunit/phpunit": "^9.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Invoker\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "Generic and extensible callable invoker",
+ "homepage": "https://github.com/PHP-DI/Invoker",
+ "keywords": [
+ "callable",
+ "dependency",
+ "dependency-injection",
+ "injection",
+ "invoke",
+ "invoker"
+ ],
+ "time": "2020-08-01T15:36:25+00:00"
+ },
+ {
+ "name": "php-di/php-di",
+ "version": "6.2.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/PHP-DI/PHP-DI.git",
+ "reference": "40140b5bca07c5fed6919a0f1029ff67617faccd"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/PHP-DI/PHP-DI/zipball/40140b5bca07c5fed6919a0f1029ff67617faccd",
+ "reference": "40140b5bca07c5fed6919a0f1029ff67617faccd",
+ "shasum": ""
+ },
+ "require": {
+ "opis/closure": "^3.5.5",
+ "php": ">=7.2.0",
+ "php-di/invoker": "^2.0",
+ "php-di/phpdoc-reader": "^2.0.1",
+ "psr/container": "^1.0"
+ },
+ "provide": {
+ "psr/container-implementation": "^1.0"
+ },
+ "require-dev": {
+ "doctrine/annotations": "~1.2",
+ "friendsofphp/php-cs-fixer": "^2.4",
+ "mnapoli/phpunit-easymock": "^1.2",
+ "ocramius/proxy-manager": "~2.0.2",
+ "phpstan/phpstan": "^0.12",
+ "phpunit/phpunit": "^8.5"
+ },
+ "suggest": {
+ "doctrine/annotations": "Install it if you want to use annotations (version ~1.2)",
+ "ocramius/proxy-manager": "Install it if you want to use lazy injection (version ~2.0)"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "DI\\": "src/"
+ },
+ "files": [
+ "src/functions.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "The dependency injection container for humans",
+ "homepage": "https://php-di.org/",
+ "keywords": [
+ "PSR-11",
+ "container",
+ "container-interop",
+ "dependency injection",
+ "di",
+ "ioc",
+ "psr11"
+ ],
+ "funding": [
+ {
+ "url": "https://github.com/mnapoli",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/php-di/php-di",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2020-08-23T16:23:17+00:00"
+ },
+ {
+ "name": "php-di/phpdoc-reader",
+ "version": "2.1.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/PHP-DI/PhpDocReader.git",
+ "reference": "15678f7451c020226807f520efb867ad26fbbfcf"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/PHP-DI/PhpDocReader/zipball/15678f7451c020226807f520efb867ad26fbbfcf",
+ "reference": "15678f7451c020226807f520efb867ad26fbbfcf",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.4.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "~4.6"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "PhpDocReader\\": "src/PhpDocReader"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "PhpDocReader parses @var and @param values in PHP docblocks (supports namespaced class names with the same resolution rules as PHP)",
+ "keywords": [
+ "phpdoc",
+ "reflection"
+ ],
+ "time": "2019-09-26T11:24:58+00:00"
+ },
+ {
+ "name": "psr/container",
+ "version": "1.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/container.git",
+ "reference": "b7ce3b176482dbbc1245ebf52b181af44c2cf55f"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/container/zipball/b7ce3b176482dbbc1245ebf52b181af44c2cf55f",
+ "reference": "b7ce3b176482dbbc1245ebf52b181af44c2cf55f",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Container\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "description": "Common Container Interface (PHP FIG PSR-11)",
+ "homepage": "https://github.com/php-fig/container",
+ "keywords": [
+ "PSR-11",
+ "container",
+ "container-interface",
+ "container-interop",
+ "psr"
+ ],
+ "time": "2017-02-14T16:28:37+00:00"
+ },
+ {
+ "name": "psr/http-factory",
+ "version": "1.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/http-factory.git",
+ "reference": "12ac7fcd07e5b077433f5f2bee95b3a771bf61be"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/http-factory/zipball/12ac7fcd07e5b077433f5f2bee95b3a771bf61be",
+ "reference": "12ac7fcd07e5b077433f5f2bee95b3a771bf61be",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.0.0",
+ "psr/http-message": "^1.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Http\\Message\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interfaces for PSR-7 HTTP message factories",
+ "keywords": [
+ "factory",
+ "http",
+ "message",
+ "psr",
+ "psr-17",
+ "psr-7",
+ "request",
+ "response"
+ ],
+ "time": "2019-04-30T12:38:16+00:00"
+ },
+ {
+ "name": "psr/http-message",
+ "version": "1.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/http-message.git",
+ "reference": "f6561bf28d520154e4b0ec72be95418abe6d9363"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/http-message/zipball/f6561bf28d520154e4b0ec72be95418abe6d9363",
+ "reference": "f6561bf28d520154e4b0ec72be95418abe6d9363",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Http\\Message\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for HTTP messages",
+ "homepage": "https://github.com/php-fig/http-message",
+ "keywords": [
+ "http",
+ "http-message",
+ "psr",
+ "psr-7",
+ "request",
+ "response"
+ ],
+ "time": "2016-08-06T14:39:51+00:00"
+ },
+ {
+ "name": "psr/http-server-handler",
+ "version": "1.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/http-server-handler.git",
+ "reference": "aff2f80e33b7f026ec96bb42f63242dc50ffcae7"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/http-server-handler/zipball/aff2f80e33b7f026ec96bb42f63242dc50ffcae7",
+ "reference": "aff2f80e33b7f026ec96bb42f63242dc50ffcae7",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.0",
+ "psr/http-message": "^1.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Http\\Server\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for HTTP server-side request handler",
+ "keywords": [
+ "handler",
+ "http",
+ "http-interop",
+ "psr",
+ "psr-15",
+ "psr-7",
+ "request",
+ "response",
+ "server"
+ ],
+ "time": "2018-10-30T16:46:14+00:00"
+ },
+ {
+ "name": "psr/http-server-middleware",
+ "version": "1.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/http-server-middleware.git",
+ "reference": "2296f45510945530b9dceb8bcedb5cb84d40c5f5"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/http-server-middleware/zipball/2296f45510945530b9dceb8bcedb5cb84d40c5f5",
+ "reference": "2296f45510945530b9dceb8bcedb5cb84d40c5f5",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.0",
+ "psr/http-message": "^1.0",
+ "psr/http-server-handler": "^1.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Http\\Server\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for HTTP server-side middleware",
+ "keywords": [
+ "http",
+ "http-interop",
+ "middleware",
+ "psr",
+ "psr-15",
+ "psr-7",
+ "request",
+ "response"
+ ],
+ "time": "2018-10-30T17:12:04+00:00"
+ },
+ {
+ "name": "psr/log",
+ "version": "1.1.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/log.git",
+ "reference": "0f73288fd15629204f9d42b7055f72dacbe811fc"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/log/zipball/0f73288fd15629204f9d42b7055f72dacbe811fc",
+ "reference": "0f73288fd15629204f9d42b7055f72dacbe811fc",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.1.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Log\\": "Psr/Log/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for logging libraries",
+ "homepage": "https://github.com/php-fig/log",
+ "keywords": [
+ "log",
+ "psr",
+ "psr-3"
+ ],
+ "time": "2020-03-23T09:12:05+00:00"
+ },
+ {
+ "name": "ralouphie/getallheaders",
+ "version": "3.0.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/ralouphie/getallheaders.git",
+ "reference": "120b605dfeb996808c31b6477290a714d356e822"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/ralouphie/getallheaders/zipball/120b605dfeb996808c31b6477290a714d356e822",
+ "reference": "120b605dfeb996808c31b6477290a714d356e822",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.6"
+ },
+ "require-dev": {
+ "php-coveralls/php-coveralls": "^2.1",
+ "phpunit/phpunit": "^5 || ^6.5"
+ },
+ "type": "library",
+ "autoload": {
+ "files": [
+ "src/getallheaders.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Ralph Khattar",
+ "email": "ralph.khattar@gmail.com"
+ }
+ ],
+ "description": "A polyfill for getallheaders.",
+ "time": "2019-03-08T08:55:37+00:00"
+ },
+ {
+ "name": "slim/psr7",
+ "version": "1.2.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/slimphp/Slim-Psr7.git",
+ "reference": "832912cb3c2a807d472ef0ac392552e85703a667"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/slimphp/Slim-Psr7/zipball/832912cb3c2a807d472ef0ac392552e85703a667",
+ "reference": "832912cb3c2a807d472ef0ac392552e85703a667",
+ "shasum": ""
+ },
+ "require": {
+ "fig/http-message-util": "^1.1.4",
+ "php": "^7.2",
+ "psr/http-factory": "^1.0",
+ "psr/http-message": "^1.0",
+ "ralouphie/getallheaders": "^3"
+ },
+ "provide": {
+ "psr/http-factory-implementation": "1.0",
+ "psr/http-message-implementation": "1.0"
+ },
+ "require-dev": {
+ "adriansuter/php-autoload-override": "^1.2",
+ "ext-json": "*",
+ "http-interop/http-factory-tests": "^0.6.0",
+ "php-http/psr7-integration-tests": "dev-master",
+ "phpstan/phpstan": "^0.12",
+ "phpunit/phpunit": "^8.5",
+ "squizlabs/php_codesniffer": "^3.5"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Slim\\Psr7\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Josh Lockhart",
+ "email": "hello@joshlockhart.com",
+ "homepage": "http://joshlockhart.com"
+ },
+ {
+ "name": "Andrew Smith",
+ "email": "a.smith@silentworks.co.uk",
+ "homepage": "http://silentworks.co.uk"
+ },
+ {
+ "name": "Rob Allen",
+ "email": "rob@akrabat.com",
+ "homepage": "http://akrabat.com"
+ },
+ {
+ "name": "Pierre Berube",
+ "email": "pierre@lgse.com",
+ "homepage": "http://www.lgse.com"
+ }
+ ],
+ "description": "Strict PSR-7 implementation",
+ "homepage": "https://www.slimframework.com",
+ "keywords": [
+ "http",
+ "psr-7",
+ "psr7"
+ ],
+ "time": "2020-08-18T22:49:11+00:00"
+ },
+ {
+ "name": "slim/slim",
+ "version": "4.5.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/slimphp/Slim.git",
+ "reference": "5613cbb521081ed676d5d7eb3e44f2b80a818c24"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/slimphp/Slim/zipball/5613cbb521081ed676d5d7eb3e44f2b80a818c24",
+ "reference": "5613cbb521081ed676d5d7eb3e44f2b80a818c24",
+ "shasum": ""
+ },
+ "require": {
+ "ext-json": "*",
+ "nikic/fast-route": "^1.3",
+ "php": "^7.2",
+ "psr/container": "^1.0",
+ "psr/http-factory": "^1.0",
+ "psr/http-message": "^1.0",
+ "psr/http-server-handler": "^1.0",
+ "psr/http-server-middleware": "^1.0",
+ "psr/log": "^1.1"
+ },
+ "require-dev": {
+ "adriansuter/php-autoload-override": "^1.0",
+ "ext-simplexml": "*",
+ "guzzlehttp/psr7": "^1.5",
+ "http-interop/http-factory-guzzle": "^1.0",
+ "laminas/laminas-diactoros": "^2.1",
+ "nyholm/psr7": "^1.1",
+ "nyholm/psr7-server": "^0.3.0",
+ "phpspec/prophecy": "^1.10",
+ "phpstan/phpstan": "^0.11.5",
+ "phpunit/phpunit": "^8.5",
+ "slim/http": "^1.0",
+ "slim/psr7": "^1.0",
+ "squizlabs/php_codesniffer": "^3.5"
+ },
+ "suggest": {
+ "ext-simplexml": "Needed to support XML format in BodyParsingMiddleware",
+ "ext-xml": "Needed to support XML format in BodyParsingMiddleware",
+ "php-di/php-di": "PHP-DI is the recommended container library to be used with Slim",
+ "slim/psr7": "Slim PSR-7 implementation. See https://www.slimframework.com/docs/v4/start/installation.html for more information."
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Slim\\": "Slim"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Josh Lockhart",
+ "email": "hello@joshlockhart.com",
+ "homepage": "https://joshlockhart.com"
+ },
+ {
+ "name": "Andrew Smith",
+ "email": "a.smith@silentworks.co.uk",
+ "homepage": "http://silentworks.co.uk"
+ },
+ {
+ "name": "Rob Allen",
+ "email": "rob@akrabat.com",
+ "homepage": "http://akrabat.com"
+ },
+ {
+ "name": "Pierre Berube",
+ "email": "pierre@lgse.com",
+ "homepage": "http://www.lgse.com"
+ },
+ {
+ "name": "Gabriel Manricks",
+ "email": "gmanricks@me.com",
+ "homepage": "http://gabrielmanricks.com"
+ }
+ ],
+ "description": "Slim is a PHP micro framework that helps you quickly write simple yet powerful web applications and APIs",
+ "homepage": "https://www.slimframework.com",
+ "keywords": [
+ "api",
+ "framework",
+ "micro",
+ "router"
+ ],
+ "funding": [
+ {
+ "url": "https://opencollective.com/slimphp",
+ "type": "open_collective"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/slim/slim",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2020-04-14T20:49:48+00:00"
+ }
+ ],
+ "packages-dev": [
+ {
+ "name": "doctrine/instantiator",
+ "version": "1.3.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/doctrine/instantiator.git",
+ "reference": "f350df0268e904597e3bd9c4685c53e0e333feea"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/doctrine/instantiator/zipball/f350df0268e904597e3bd9c4685c53e0e333feea",
+ "reference": "f350df0268e904597e3bd9c4685c53e0e333feea",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1 || ^8.0"
+ },
+ "require-dev": {
+ "doctrine/coding-standard": "^6.0",
+ "ext-pdo": "*",
+ "ext-phar": "*",
+ "phpbench/phpbench": "^0.13",
+ "phpstan/phpstan-phpunit": "^0.11",
+ "phpstan/phpstan-shim": "^0.11",
+ "phpunit/phpunit": "^7.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.2.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Doctrine\\Instantiator\\": "src/Doctrine/Instantiator/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Marco Pivetta",
+ "email": "ocramius@gmail.com",
+ "homepage": "http://ocramius.github.com/"
+ }
+ ],
+ "description": "A small, lightweight utility to instantiate objects in PHP without invoking their constructors",
+ "homepage": "https://www.doctrine-project.org/projects/instantiator.html",
+ "keywords": [
+ "constructor",
+ "instantiate"
+ ],
+ "funding": [
+ {
+ "url": "https://www.doctrine-project.org/sponsorship.html",
+ "type": "custom"
+ },
+ {
+ "url": "https://www.patreon.com/phpdoctrine",
+ "type": "patreon"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/doctrine%2Finstantiator",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2020-05-29T17:27:14+00:00"
+ },
+ {
+ "name": "jangregor/phpstan-prophecy",
+ "version": "0.8.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/Jan0707/phpstan-prophecy.git",
+ "reference": "d599ec96dce8087ba4f32d7d9f9cb4565239e3db"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/Jan0707/phpstan-prophecy/zipball/d599ec96dce8087ba4f32d7d9f9cb4565239e3db",
+ "reference": "d599ec96dce8087ba4f32d7d9f9cb4565239e3db",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1",
+ "phpstan/phpstan": "^0.12.6"
+ },
+ "conflict": {
+ "phpspec/prophecy": "<1.7.0,>=2.0.0",
+ "phpunit/phpunit": "<6.0.0,>=10.0.0"
+ },
+ "require-dev": {
+ "ergebnis/composer-normalize": "^2.1.1",
+ "ergebnis/license": "^1.0.0",
+ "ergebnis/php-cs-fixer-config": "~1.1.2",
+ "phpspec/prophecy": "^1.7.0",
+ "phpunit/phpunit": "^6.0.0 || ^7.0.0 || ^8.0.0 || ^9.0.0"
+ },
+ "type": "phpstan-extension",
+ "extra": {
+ "phpstan": {
+ "includes": [
+ "extension.neon"
+ ]
+ },
+ "violinist": {
+ "allow_updates_beyond_constraint": 0,
+ "one_pull_request_per_package": 1,
+ "update_with_dependencies": 1
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "JanGregor\\Prophecy\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Jan Gregor Emge-Triebel",
+ "email": "jan@jangregor.me"
+ }
+ ],
+ "description": "Provides a phpstan/phpstan extension for phpspec/prophecy",
+ "funding": [
+ {
+ "url": "https://www.buymeacoffee.com/localheinz",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/localheinz",
+ "type": "github"
+ }
+ ],
+ "time": "2020-05-12T08:04:04+00:00"
+ },
+ {
+ "name": "myclabs/deep-copy",
+ "version": "1.10.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/myclabs/DeepCopy.git",
+ "reference": "969b211f9a51aa1f6c01d1d2aef56d3bd91598e5"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/myclabs/DeepCopy/zipball/969b211f9a51aa1f6c01d1d2aef56d3bd91598e5",
+ "reference": "969b211f9a51aa1f6c01d1d2aef56d3bd91598e5",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1 || ^8.0"
+ },
+ "replace": {
+ "myclabs/deep-copy": "self.version"
+ },
+ "require-dev": {
+ "doctrine/collections": "^1.0",
+ "doctrine/common": "^2.6",
+ "phpunit/phpunit": "^7.1"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "DeepCopy\\": "src/DeepCopy/"
+ },
+ "files": [
+ "src/DeepCopy/deep_copy.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "Create deep copies (clones) of your objects",
+ "keywords": [
+ "clone",
+ "copy",
+ "duplicate",
+ "object",
+ "object graph"
+ ],
+ "funding": [
+ {
+ "url": "https://tidelift.com/funding/github/packagist/myclabs/deep-copy",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2020-06-29T13:22:24+00:00"
+ },
+ {
+ "name": "phar-io/manifest",
+ "version": "1.0.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/phar-io/manifest.git",
+ "reference": "7761fcacf03b4d4f16e7ccb606d4879ca431fcf4"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/phar-io/manifest/zipball/7761fcacf03b4d4f16e7ccb606d4879ca431fcf4",
+ "reference": "7761fcacf03b4d4f16e7ccb606d4879ca431fcf4",
+ "shasum": ""
+ },
+ "require": {
+ "ext-dom": "*",
+ "ext-phar": "*",
+ "phar-io/version": "^2.0",
+ "php": "^5.6 || ^7.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.0.x-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Arne Blankerts",
+ "email": "arne@blankerts.de",
+ "role": "Developer"
+ },
+ {
+ "name": "Sebastian Heuer",
+ "email": "sebastian@phpeople.de",
+ "role": "Developer"
+ },
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "Developer"
+ }
+ ],
+ "description": "Component for reading phar.io manifest information from a PHP Archive (PHAR)",
+ "time": "2018-07-08T19:23:20+00:00"
+ },
+ {
+ "name": "phar-io/version",
+ "version": "2.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/phar-io/version.git",
+ "reference": "45a2ec53a73c70ce41d55cedef9063630abaf1b6"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/phar-io/version/zipball/45a2ec53a73c70ce41d55cedef9063630abaf1b6",
+ "reference": "45a2ec53a73c70ce41d55cedef9063630abaf1b6",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^5.6 || ^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Arne Blankerts",
+ "email": "arne@blankerts.de",
+ "role": "Developer"
+ },
+ {
+ "name": "Sebastian Heuer",
+ "email": "sebastian@phpeople.de",
+ "role": "Developer"
+ },
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "Developer"
+ }
+ ],
+ "description": "Library for handling version information and constraints",
+ "time": "2018-07-08T19:19:57+00:00"
+ },
+ {
+ "name": "phpdocumentor/reflection-common",
+ "version": "2.2.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/phpDocumentor/ReflectionCommon.git",
+ "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/phpDocumentor/ReflectionCommon/zipball/1d01c49d4ed62f25aa84a747ad35d5a16924662b",
+ "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2 || ^8.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-2.x": "2.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "phpDocumentor\\Reflection\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Jaap van Otterdijk",
+ "email": "opensource@ijaap.nl"
+ }
+ ],
+ "description": "Common reflection classes used by phpdocumentor to reflect the code structure",
+ "homepage": "http://www.phpdoc.org",
+ "keywords": [
+ "FQSEN",
+ "phpDocumentor",
+ "phpdoc",
+ "reflection",
+ "static analysis"
+ ],
+ "time": "2020-06-27T09:03:43+00:00"
+ },
+ {
+ "name": "phpdocumentor/reflection-docblock",
+ "version": "5.2.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/phpDocumentor/ReflectionDocBlock.git",
+ "reference": "d870572532cd70bc3fab58f2e23ad423c8404c44"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/phpDocumentor/ReflectionDocBlock/zipball/d870572532cd70bc3fab58f2e23ad423c8404c44",
+ "reference": "d870572532cd70bc3fab58f2e23ad423c8404c44",
+ "shasum": ""
+ },
+ "require": {
+ "ext-filter": "*",
+ "php": "^7.2 || ^8.0",
+ "phpdocumentor/reflection-common": "^2.2",
+ "phpdocumentor/type-resolver": "^1.3",
+ "webmozart/assert": "^1.9.1"
+ },
+ "require-dev": {
+ "mockery/mockery": "~1.3.2"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "5.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "phpDocumentor\\Reflection\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Mike van Riel",
+ "email": "me@mikevanriel.com"
+ },
+ {
+ "name": "Jaap van Otterdijk",
+ "email": "account@ijaap.nl"
+ }
+ ],
+ "description": "With this component, a library can provide support for annotations via DocBlocks or otherwise retrieve information that is embedded in a DocBlock.",
+ "time": "2020-08-15T11:14:08+00:00"
+ },
+ {
+ "name": "phpdocumentor/type-resolver",
+ "version": "1.3.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/phpDocumentor/TypeResolver.git",
+ "reference": "e878a14a65245fbe78f8080eba03b47c3b705651"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/phpDocumentor/TypeResolver/zipball/e878a14a65245fbe78f8080eba03b47c3b705651",
+ "reference": "e878a14a65245fbe78f8080eba03b47c3b705651",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2 || ^8.0",
+ "phpdocumentor/reflection-common": "^2.0"
+ },
+ "require-dev": {
+ "ext-tokenizer": "*"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-1.x": "1.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "phpDocumentor\\Reflection\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Mike van Riel",
+ "email": "me@mikevanriel.com"
+ }
+ ],
+ "description": "A PSR-5 based resolver of Class names, Types and Structural Element Names",
+ "time": "2020-06-27T10:12:23+00:00"
+ },
+ {
+ "name": "phpspec/prophecy",
+ "version": "1.11.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/phpspec/prophecy.git",
+ "reference": "b20034be5efcdab4fb60ca3a29cba2949aead160"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/phpspec/prophecy/zipball/b20034be5efcdab4fb60ca3a29cba2949aead160",
+ "reference": "b20034be5efcdab4fb60ca3a29cba2949aead160",
+ "shasum": ""
+ },
+ "require": {
+ "doctrine/instantiator": "^1.2",
+ "php": "^7.2",
+ "phpdocumentor/reflection-docblock": "^5.0",
+ "sebastian/comparator": "^3.0 || ^4.0",
+ "sebastian/recursion-context": "^3.0 || ^4.0"
+ },
+ "require-dev": {
+ "phpspec/phpspec": "^6.0",
+ "phpunit/phpunit": "^8.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.11.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Prophecy\\": "src/Prophecy"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Konstantin Kudryashov",
+ "email": "ever.zet@gmail.com",
+ "homepage": "http://everzet.com"
+ },
+ {
+ "name": "Marcello Duarte",
+ "email": "marcello.duarte@gmail.com"
+ }
+ ],
+ "description": "Highly opinionated mocking framework for PHP 5.3+",
+ "homepage": "https://github.com/phpspec/prophecy",
+ "keywords": [
+ "Double",
+ "Dummy",
+ "fake",
+ "mock",
+ "spy",
+ "stub"
+ ],
+ "time": "2020-07-08T12:44:21+00:00"
+ },
+ {
+ "name": "phpstan/extension-installer",
+ "version": "1.0.5",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/phpstan/extension-installer.git",
+ "reference": "5c2da3846819f951385cb6a25d3277051481c48a"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/phpstan/extension-installer/zipball/5c2da3846819f951385cb6a25d3277051481c48a",
+ "reference": "5c2da3846819f951385cb6a25d3277051481c48a",
+ "shasum": ""
+ },
+ "require": {
+ "composer-plugin-api": "^1.1 || ^2.0",
+ "php": "^7.1 || ^8.0",
+ "phpstan/phpstan": ">=0.11.6"
+ },
+ "require-dev": {
+ "composer/composer": "^1.8",
+ "consistence/coding-standard": "^3.8",
+ "dealerdirect/phpcodesniffer-composer-installer": "^0.7.0",
+ "ergebnis/composer-normalize": "^2.0.2",
+ "phing/phing": "^2.16",
+ "php-parallel-lint/php-parallel-lint": "^1.2.0",
+ "phpstan/phpstan-strict-rules": "^0.11",
+ "slevomat/coding-standard": "^5.0.4"
+ },
+ "type": "composer-plugin",
+ "extra": {
+ "class": "PHPStan\\ExtensionInstaller\\Plugin"
+ },
+ "autoload": {
+ "psr-4": {
+ "PHPStan\\ExtensionInstaller\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "Composer plugin for automatic installation of PHPStan extensions",
+ "time": "2020-08-30T12:06:42+00:00"
+ },
+ {
+ "name": "phpstan/phpstan",
+ "version": "0.12.42",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/phpstan/phpstan.git",
+ "reference": "7c43b7c2d5ca6554f6231e82e342a710163ac5f4"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/phpstan/phpstan/zipball/7c43b7c2d5ca6554f6231e82e342a710163ac5f4",
+ "reference": "7c43b7c2d5ca6554f6231e82e342a710163ac5f4",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1|^8.0"
+ },
+ "conflict": {
+ "phpstan/phpstan-shim": "*"
+ },
+ "bin": [
+ "phpstan",
+ "phpstan.phar"
+ ],
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "0.12-dev"
+ }
+ },
+ "autoload": {
+ "files": [
+ "bootstrap.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "PHPStan - PHP Static Analysis Tool",
+ "funding": [
+ {
+ "url": "https://github.com/ondrejmirtes",
+ "type": "github"
+ },
+ {
+ "url": "https://www.patreon.com/phpstan",
+ "type": "patreon"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/phpstan/phpstan",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2020-09-02T13:14:53+00:00"
+ },
+ {
+ "name": "phpunit/php-code-coverage",
+ "version": "7.0.10",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/php-code-coverage.git",
+ "reference": "f1884187926fbb755a9aaf0b3836ad3165b478bf"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/php-code-coverage/zipball/f1884187926fbb755a9aaf0b3836ad3165b478bf",
+ "reference": "f1884187926fbb755a9aaf0b3836ad3165b478bf",
+ "shasum": ""
+ },
+ "require": {
+ "ext-dom": "*",
+ "ext-xmlwriter": "*",
+ "php": "^7.2",
+ "phpunit/php-file-iterator": "^2.0.2",
+ "phpunit/php-text-template": "^1.2.1",
+ "phpunit/php-token-stream": "^3.1.1",
+ "sebastian/code-unit-reverse-lookup": "^1.0.1",
+ "sebastian/environment": "^4.2.2",
+ "sebastian/version": "^2.0.1",
+ "theseer/tokenizer": "^1.1.3"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^8.2.2"
+ },
+ "suggest": {
+ "ext-xdebug": "^2.7.2"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "7.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Library that provides collection, processing, and rendering functionality for PHP code coverage information.",
+ "homepage": "https://github.com/sebastianbergmann/php-code-coverage",
+ "keywords": [
+ "coverage",
+ "testing",
+ "xunit"
+ ],
+ "time": "2019-11-20T13:55:58+00:00"
+ },
+ {
+ "name": "phpunit/php-file-iterator",
+ "version": "2.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/php-file-iterator.git",
+ "reference": "050bedf145a257b1ff02746c31894800e5122946"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/php-file-iterator/zipball/050bedf145a257b1ff02746c31894800e5122946",
+ "reference": "050bedf145a257b1ff02746c31894800e5122946",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^7.1"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.0.x-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "FilterIterator implementation that filters files based on a list of suffixes.",
+ "homepage": "https://github.com/sebastianbergmann/php-file-iterator/",
+ "keywords": [
+ "filesystem",
+ "iterator"
+ ],
+ "time": "2018-09-13T20:33:42+00:00"
+ },
+ {
+ "name": "phpunit/php-text-template",
+ "version": "1.2.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/php-text-template.git",
+ "reference": "31f8b717e51d9a2afca6c9f046f5d69fc27c8686"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/php-text-template/zipball/31f8b717e51d9a2afca6c9f046f5d69fc27c8686",
+ "reference": "31f8b717e51d9a2afca6c9f046f5d69fc27c8686",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.3"
+ },
+ "type": "library",
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Simple template engine.",
+ "homepage": "https://github.com/sebastianbergmann/php-text-template/",
+ "keywords": [
+ "template"
+ ],
+ "time": "2015-06-21T13:50:34+00:00"
+ },
+ {
+ "name": "phpunit/php-timer",
+ "version": "2.1.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/php-timer.git",
+ "reference": "1038454804406b0b5f5f520358e78c1c2f71501e"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/php-timer/zipball/1038454804406b0b5f5f520358e78c1c2f71501e",
+ "reference": "1038454804406b0b5f5f520358e78c1c2f71501e",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^7.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.1-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Utility class for timing",
+ "homepage": "https://github.com/sebastianbergmann/php-timer/",
+ "keywords": [
+ "timer"
+ ],
+ "time": "2019-06-07T04:22:29+00:00"
+ },
+ {
+ "name": "phpunit/php-token-stream",
+ "version": "3.1.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/php-token-stream.git",
+ "reference": "995192df77f63a59e47f025390d2d1fdf8f425ff"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/php-token-stream/zipball/995192df77f63a59e47f025390d2d1fdf8f425ff",
+ "reference": "995192df77f63a59e47f025390d2d1fdf8f425ff",
+ "shasum": ""
+ },
+ "require": {
+ "ext-tokenizer": "*",
+ "php": "^7.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^7.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.1-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Wrapper around PHP's tokenizer extension.",
+ "homepage": "https://github.com/sebastianbergmann/php-token-stream/",
+ "keywords": [
+ "tokenizer"
+ ],
+ "abandoned": true,
+ "time": "2019-09-17T06:23:10+00:00"
+ },
+ {
+ "name": "phpunit/phpunit",
+ "version": "8.5.8",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/phpunit.git",
+ "reference": "34c18baa6a44f1d1fbf0338907139e9dce95b997"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/phpunit/zipball/34c18baa6a44f1d1fbf0338907139e9dce95b997",
+ "reference": "34c18baa6a44f1d1fbf0338907139e9dce95b997",
+ "shasum": ""
+ },
+ "require": {
+ "doctrine/instantiator": "^1.2.0",
+ "ext-dom": "*",
+ "ext-json": "*",
+ "ext-libxml": "*",
+ "ext-mbstring": "*",
+ "ext-xml": "*",
+ "ext-xmlwriter": "*",
+ "myclabs/deep-copy": "^1.9.1",
+ "phar-io/manifest": "^1.0.3",
+ "phar-io/version": "^2.0.1",
+ "php": "^7.2",
+ "phpspec/prophecy": "^1.8.1",
+ "phpunit/php-code-coverage": "^7.0.7",
+ "phpunit/php-file-iterator": "^2.0.2",
+ "phpunit/php-text-template": "^1.2.1",
+ "phpunit/php-timer": "^2.1.2",
+ "sebastian/comparator": "^3.0.2",
+ "sebastian/diff": "^3.0.2",
+ "sebastian/environment": "^4.2.2",
+ "sebastian/exporter": "^3.1.1",
+ "sebastian/global-state": "^3.0.0",
+ "sebastian/object-enumerator": "^3.0.3",
+ "sebastian/resource-operations": "^2.0.1",
+ "sebastian/type": "^1.1.3",
+ "sebastian/version": "^2.0.1"
+ },
+ "require-dev": {
+ "ext-pdo": "*"
+ },
+ "suggest": {
+ "ext-soap": "*",
+ "ext-xdebug": "*",
+ "phpunit/php-invoker": "^2.0.0"
+ },
+ "bin": [
+ "phpunit"
+ ],
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "8.5-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "The PHP Unit Testing framework.",
+ "homepage": "https://phpunit.de/",
+ "keywords": [
+ "phpunit",
+ "testing",
+ "xunit"
+ ],
+ "funding": [
+ {
+ "url": "https://phpunit.de/donate.html",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2020-06-22T07:06:58+00:00"
+ },
+ {
+ "name": "sebastian/code-unit-reverse-lookup",
+ "version": "1.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/code-unit-reverse-lookup.git",
+ "reference": "4419fcdb5eabb9caa61a27c7a1db532a6b55dd18"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/code-unit-reverse-lookup/zipball/4419fcdb5eabb9caa61a27c7a1db532a6b55dd18",
+ "reference": "4419fcdb5eabb9caa61a27c7a1db532a6b55dd18",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^5.6 || ^7.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^5.7 || ^6.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.0.x-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Looks up which function or method a line of code belongs to",
+ "homepage": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/",
+ "time": "2017-03-04T06:30:41+00:00"
+ },
+ {
+ "name": "sebastian/comparator",
+ "version": "3.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/comparator.git",
+ "reference": "5de4fc177adf9bce8df98d8d141a7559d7ccf6da"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/comparator/zipball/5de4fc177adf9bce8df98d8d141a7559d7ccf6da",
+ "reference": "5de4fc177adf9bce8df98d8d141a7559d7ccf6da",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1",
+ "sebastian/diff": "^3.0",
+ "sebastian/exporter": "^3.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^7.1"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Jeff Welch",
+ "email": "whatthejeff@gmail.com"
+ },
+ {
+ "name": "Volker Dusch",
+ "email": "github@wallbash.com"
+ },
+ {
+ "name": "Bernhard Schussek",
+ "email": "bschussek@2bepublished.at"
+ },
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Provides the functionality to compare PHP values for equality",
+ "homepage": "https://github.com/sebastianbergmann/comparator",
+ "keywords": [
+ "comparator",
+ "compare",
+ "equality"
+ ],
+ "time": "2018-07-12T15:12:46+00:00"
+ },
+ {
+ "name": "sebastian/diff",
+ "version": "3.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/diff.git",
+ "reference": "720fcc7e9b5cf384ea68d9d930d480907a0c1a29"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/diff/zipball/720fcc7e9b5cf384ea68d9d930d480907a0c1a29",
+ "reference": "720fcc7e9b5cf384ea68d9d930d480907a0c1a29",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^7.5 || ^8.0",
+ "symfony/process": "^2 || ^3.3 || ^4"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Kore Nordmann",
+ "email": "mail@kore-nordmann.de"
+ },
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Diff implementation",
+ "homepage": "https://github.com/sebastianbergmann/diff",
+ "keywords": [
+ "diff",
+ "udiff",
+ "unidiff",
+ "unified diff"
+ ],
+ "time": "2019-02-04T06:01:07+00:00"
+ },
+ {
+ "name": "sebastian/environment",
+ "version": "4.2.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/environment.git",
+ "reference": "464c90d7bdf5ad4e8a6aea15c091fec0603d4368"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/environment/zipball/464c90d7bdf5ad4e8a6aea15c091fec0603d4368",
+ "reference": "464c90d7bdf5ad4e8a6aea15c091fec0603d4368",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^7.5"
+ },
+ "suggest": {
+ "ext-posix": "*"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "4.2-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Provides functionality to handle HHVM/PHP environments",
+ "homepage": "http://www.github.com/sebastianbergmann/environment",
+ "keywords": [
+ "Xdebug",
+ "environment",
+ "hhvm"
+ ],
+ "time": "2019-11-20T08:46:58+00:00"
+ },
+ {
+ "name": "sebastian/exporter",
+ "version": "3.1.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/exporter.git",
+ "reference": "68609e1261d215ea5b21b7987539cbfbe156ec3e"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/exporter/zipball/68609e1261d215ea5b21b7987539cbfbe156ec3e",
+ "reference": "68609e1261d215ea5b21b7987539cbfbe156ec3e",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.0",
+ "sebastian/recursion-context": "^3.0"
+ },
+ "require-dev": {
+ "ext-mbstring": "*",
+ "phpunit/phpunit": "^6.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.1.x-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ },
+ {
+ "name": "Jeff Welch",
+ "email": "whatthejeff@gmail.com"
+ },
+ {
+ "name": "Volker Dusch",
+ "email": "github@wallbash.com"
+ },
+ {
+ "name": "Adam Harvey",
+ "email": "aharvey@php.net"
+ },
+ {
+ "name": "Bernhard Schussek",
+ "email": "bschussek@gmail.com"
+ }
+ ],
+ "description": "Provides the functionality to export PHP variables for visualization",
+ "homepage": "http://www.github.com/sebastianbergmann/exporter",
+ "keywords": [
+ "export",
+ "exporter"
+ ],
+ "time": "2019-09-14T09:02:43+00:00"
+ },
+ {
+ "name": "sebastian/global-state",
+ "version": "3.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/global-state.git",
+ "reference": "edf8a461cf1d4005f19fb0b6b8b95a9f7fa0adc4"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/global-state/zipball/edf8a461cf1d4005f19fb0b6b8b95a9f7fa0adc4",
+ "reference": "edf8a461cf1d4005f19fb0b6b8b95a9f7fa0adc4",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2",
+ "sebastian/object-reflector": "^1.1.1",
+ "sebastian/recursion-context": "^3.0"
+ },
+ "require-dev": {
+ "ext-dom": "*",
+ "phpunit/phpunit": "^8.0"
+ },
+ "suggest": {
+ "ext-uopz": "*"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Snapshotting of global state",
+ "homepage": "http://www.github.com/sebastianbergmann/global-state",
+ "keywords": [
+ "global state"
+ ],
+ "time": "2019-02-01T05:30:01+00:00"
+ },
+ {
+ "name": "sebastian/object-enumerator",
+ "version": "3.0.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/object-enumerator.git",
+ "reference": "7cfd9e65d11ffb5af41198476395774d4c8a84c5"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/object-enumerator/zipball/7cfd9e65d11ffb5af41198476395774d4c8a84c5",
+ "reference": "7cfd9e65d11ffb5af41198476395774d4c8a84c5",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.0",
+ "sebastian/object-reflector": "^1.1.1",
+ "sebastian/recursion-context": "^3.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^6.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.0.x-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Traverses array structures and object graphs to enumerate all referenced objects",
+ "homepage": "https://github.com/sebastianbergmann/object-enumerator/",
+ "time": "2017-08-03T12:35:26+00:00"
+ },
+ {
+ "name": "sebastian/object-reflector",
+ "version": "1.1.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/object-reflector.git",
+ "reference": "773f97c67f28de00d397be301821b06708fca0be"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/object-reflector/zipball/773f97c67f28de00d397be301821b06708fca0be",
+ "reference": "773f97c67f28de00d397be301821b06708fca0be",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^6.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.1-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Allows reflection of object attributes, including inherited and non-public ones",
+ "homepage": "https://github.com/sebastianbergmann/object-reflector/",
+ "time": "2017-03-29T09:07:27+00:00"
+ },
+ {
+ "name": "sebastian/recursion-context",
+ "version": "3.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/recursion-context.git",
+ "reference": "5b0cd723502bac3b006cbf3dbf7a1e3fcefe4fa8"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/recursion-context/zipball/5b0cd723502bac3b006cbf3dbf7a1e3fcefe4fa8",
+ "reference": "5b0cd723502bac3b006cbf3dbf7a1e3fcefe4fa8",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^6.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.0.x-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Jeff Welch",
+ "email": "whatthejeff@gmail.com"
+ },
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ },
+ {
+ "name": "Adam Harvey",
+ "email": "aharvey@php.net"
+ }
+ ],
+ "description": "Provides functionality to recursively process PHP variables",
+ "homepage": "http://www.github.com/sebastianbergmann/recursion-context",
+ "time": "2017-03-03T06:23:57+00:00"
+ },
+ {
+ "name": "sebastian/resource-operations",
+ "version": "2.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/resource-operations.git",
+ "reference": "4d7a795d35b889bf80a0cc04e08d77cedfa917a9"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/resource-operations/zipball/4d7a795d35b889bf80a0cc04e08d77cedfa917a9",
+ "reference": "4d7a795d35b889bf80a0cc04e08d77cedfa917a9",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Provides a list of PHP built-in functions that operate on resources",
+ "homepage": "https://www.github.com/sebastianbergmann/resource-operations",
+ "time": "2018-10-04T04:07:39+00:00"
+ },
+ {
+ "name": "sebastian/type",
+ "version": "1.1.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/type.git",
+ "reference": "3aaaa15fa71d27650d62a948be022fe3b48541a3"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/type/zipball/3aaaa15fa71d27650d62a948be022fe3b48541a3",
+ "reference": "3aaaa15fa71d27650d62a948be022fe3b48541a3",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^8.2"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.1-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Collection of value objects that represent the types of the PHP type system",
+ "homepage": "https://github.com/sebastianbergmann/type",
+ "time": "2019-07-02T08:10:15+00:00"
+ },
+ {
+ "name": "sebastian/version",
+ "version": "2.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/version.git",
+ "reference": "99732be0ddb3361e16ad77b68ba41efc8e979019"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/version/zipball/99732be0ddb3361e16ad77b68ba41efc8e979019",
+ "reference": "99732be0ddb3361e16ad77b68ba41efc8e979019",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.6"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.0.x-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Library that helps with managing the version number of Git-hosted PHP projects",
+ "homepage": "https://github.com/sebastianbergmann/version",
+ "time": "2016-10-03T07:35:21+00:00"
+ },
+ {
+ "name": "symfony/polyfill-ctype",
+ "version": "v1.18.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/polyfill-ctype.git",
+ "reference": "1c302646f6efc070cd46856e600e5e0684d6b454"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/polyfill-ctype/zipball/1c302646f6efc070cd46856e600e5e0684d6b454",
+ "reference": "1c302646f6efc070cd46856e600e5e0684d6b454",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.3"
+ },
+ "suggest": {
+ "ext-ctype": "For best performance"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.18-dev"
+ },
+ "thanks": {
+ "name": "symfony/polyfill",
+ "url": "https://github.com/symfony/polyfill"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Polyfill\\Ctype\\": ""
+ },
+ "files": [
+ "bootstrap.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Gert de Pagter",
+ "email": "BackEndTea@gmail.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Symfony polyfill for ctype functions",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "compatibility",
+ "ctype",
+ "polyfill",
+ "portable"
+ ],
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2020-07-14T12:35:20+00:00"
+ },
+ {
+ "name": "theseer/tokenizer",
+ "version": "1.2.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/theseer/tokenizer.git",
+ "reference": "75a63c33a8577608444246075ea0af0d052e452a"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/theseer/tokenizer/zipball/75a63c33a8577608444246075ea0af0d052e452a",
+ "reference": "75a63c33a8577608444246075ea0af0d052e452a",
+ "shasum": ""
+ },
+ "require": {
+ "ext-dom": "*",
+ "ext-tokenizer": "*",
+ "ext-xmlwriter": "*",
+ "php": "^7.2 || ^8.0"
+ },
+ "type": "library",
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Arne Blankerts",
+ "email": "arne@blankerts.de",
+ "role": "Developer"
+ }
+ ],
+ "description": "A small library for converting tokenized PHP source code into XML and potentially other formats",
+ "funding": [
+ {
+ "url": "https://github.com/theseer",
+ "type": "github"
+ }
+ ],
+ "time": "2020-07-12T23:59:07+00:00"
+ },
+ {
+ "name": "webmozart/assert",
+ "version": "1.9.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/webmozart/assert.git",
+ "reference": "bafc69caeb4d49c39fd0779086c03a3738cbb389"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/webmozart/assert/zipball/bafc69caeb4d49c39fd0779086c03a3738cbb389",
+ "reference": "bafc69caeb4d49c39fd0779086c03a3738cbb389",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^5.3.3 || ^7.0 || ^8.0",
+ "symfony/polyfill-ctype": "^1.8"
+ },
+ "conflict": {
+ "phpstan/phpstan": "<0.12.20",
+ "vimeo/psalm": "<3.9.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^4.8.36 || ^7.5.13"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Webmozart\\Assert\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Bernhard Schussek",
+ "email": "bschussek@gmail.com"
+ }
+ ],
+ "description": "Assertions to validate method input/output with nice error messages.",
+ "keywords": [
+ "assert",
+ "check",
+ "validate"
+ ],
+ "time": "2020-07-08T17:02:28+00:00"
+ }
+ ],
+ "aliases": [],
+ "minimum-stability": "stable",
+ "stability-flags": [],
+ "prefer-stable": false,
+ "prefer-lowest": false,
+ "platform": {
+ "php": "^7.2",
+ "ext-json": "*"
+ },
+ "platform-dev": [],
+ "plugin-api-version": "1.1.0"
+}
diff --git a/docker-compose.yml b/docker-compose.yml
new file mode 100644
index 0000000000000000000000000000000000000000..434a8024631d5f6f5020d1746e49330cac9df937
--- /dev/null
+++ b/docker-compose.yml
@@ -0,0 +1,18 @@
+version: '3.7'
+
+volumes:
+ logs:
+ driver: local
+
+services:
+ slim:
+ image: php:7-alpine
+ working_dir: /var/www
+ command: php -S 0.0.0.0:8080 -t public
+ environment:
+ docker: "true"
+ ports:
+ - 8080:8080
+ volumes:
+ - .:/var/www
+ - logs:/var/www/logs
diff --git a/logs/README.md b/logs/README.md
new file mode 100644
index 0000000000000000000000000000000000000000..d4a602efdfc53d49a4d216eed39f4bf39e126f0a
--- /dev/null
+++ b/logs/README.md
@@ -0,0 +1 @@
+Your Slim Framework application's log files will be written to this directory.
diff --git a/phpstan.neon.dist b/phpstan.neon.dist
new file mode 100644
index 0000000000000000000000000000000000000000..45876ad85bb00cf33d04e670b51371af931932f7
--- /dev/null
+++ b/phpstan.neon.dist
@@ -0,0 +1,2 @@
+parameters:
+ level: 4
diff --git a/phpunit.xml b/phpunit.xml
new file mode 100644
index 0000000000000000000000000000000000000000..f83040094141d548f1d5ca2db29f89ed1c8d08ca
--- /dev/null
+++ b/phpunit.xml
@@ -0,0 +1,27 @@
+<phpunit
+ xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+ xsi:noNamespaceSchemaLocation="http://schema.phpunit.de/7.1/phpunit.xsd"
+ backupGlobals="false"
+ backupStaticAttributes="false"
+ beStrictAboutTestsThatDoNotTestAnything="true"
+ beStrictAboutChangesToGlobalState="true"
+ beStrictAboutOutputDuringTests="true"
+ colors="true"
+ convertErrorsToExceptions="true"
+ convertNoticesToExceptions="true"
+ convertWarningsToExceptions="true"
+ processIsolation="false"
+ stopOnFailure="false"
+ bootstrap="tests/bootstrap.php"
+>
+ <testsuites>
+ <testsuite name="Test Suite">
+ <directory>./tests/</directory>
+ </testsuite>
+ </testsuites>
+ <filter>
+ <whitelist processUncoveredFilesFromWhitelist="true">
+ <directory suffix=".php">./src/</directory>
+ </whitelist>
+ </filter>
+</phpunit>
diff --git a/public/.htaccess b/public/.htaccess
new file mode 100644
index 0000000000000000000000000000000000000000..f5d1969562278e2a0a9685d1a4aa271af601f08d
--- /dev/null
+++ b/public/.htaccess
@@ -0,0 +1,21 @@
+<IfModule mod_rewrite.c>
+ RewriteEngine On
+
+ # Some hosts may require you to use the `RewriteBase` directive.
+ # Determine the RewriteBase automatically and set it as environment variable.
+ # If you are using Apache aliases to do mass virtual hosting or installed the
+ # project in a subdirectory, the base path will be prepended to allow proper
+ # resolution of the index.php file and to redirect to the correct URI. It will
+ # work in environments without path prefix as well, providing a safe, one-size
+ # fits all solution. But as you do not need it in this case, you can comment
+ # the following 2 lines to eliminate the overhead.
+ RewriteCond %{REQUEST_URI}::$1 ^(/.+)/(.*)::\2$
+ RewriteRule ^(.*) - [E=BASE:%1]
+
+ # If the above doesn't work you might need to set the `RewriteBase` directive manually, it should be the
+ # absolute physical path to the directory that contains this htaccess file.
+ # RewriteBase /
+
+ RewriteCond %{REQUEST_FILENAME} !-f
+ RewriteRule ^ index.php [QSA,L]
+</IfModule>
diff --git a/public/index.php b/public/index.php
new file mode 100644
index 0000000000000000000000000000000000000000..57722ec7f0cad70058d5168f02b9def918e08919
--- /dev/null
+++ b/public/index.php
@@ -0,0 +1,73 @@
+<?php
+declare(strict_types=1);
+
+use App\Application\Handlers\HttpErrorHandler;
+use App\Application\Handlers\ShutdownHandler;
+use App\Application\ResponseEmitter\ResponseEmitter;
+use DI\ContainerBuilder;
+use Slim\Factory\AppFactory;
+use Slim\Factory\ServerRequestCreatorFactory;
+
+require __DIR__ . '/../vendor/autoload.php';
+
+// Instantiate PHP-DI ContainerBuilder
+$containerBuilder = new ContainerBuilder();
+
+if (false) { // Should be set to true in production
+ $containerBuilder->enableCompilation(__DIR__ . '/../var/cache');
+}
+
+// Set up settings
+$settings = require __DIR__ . '/../app/settings.php';
+$settings($containerBuilder);
+
+// Set up dependencies
+$dependencies = require __DIR__ . '/../app/dependencies.php';
+$dependencies($containerBuilder);
+
+// Set up repositories
+$repositories = require __DIR__ . '/../app/repositories.php';
+$repositories($containerBuilder);
+
+// Build PHP-DI Container instance
+$container = $containerBuilder->build();
+
+// Instantiate the app
+AppFactory::setContainer($container);
+$app = AppFactory::create();
+$callableResolver = $app->getCallableResolver();
+
+// Register middleware
+$middleware = require __DIR__ . '/../app/middleware.php';
+$middleware($app);
+
+// Register routes
+$routes = require __DIR__ . '/../app/routes.php';
+$routes($app);
+
+/** @var bool $displayErrorDetails */
+$displayErrorDetails = $container->get('settings')['displayErrorDetails'];
+
+// Create Request object from globals
+$serverRequestCreator = ServerRequestCreatorFactory::create();
+$request = $serverRequestCreator->createServerRequestFromGlobals();
+
+// Create Error Handler
+$responseFactory = $app->getResponseFactory();
+$errorHandler = new HttpErrorHandler($callableResolver, $responseFactory);
+
+// Create Shutdown Handler
+$shutdownHandler = new ShutdownHandler($request, $errorHandler, $displayErrorDetails);
+register_shutdown_function($shutdownHandler);
+
+// Add Routing Middleware
+$app->addRoutingMiddleware();
+
+// Add Error Middleware
+$errorMiddleware = $app->addErrorMiddleware($displayErrorDetails, false, false);
+$errorMiddleware->setDefaultErrorHandler($errorHandler);
+
+// Run App & Emit Response
+$response = $app->handle($request);
+$responseEmitter = new ResponseEmitter();
+$responseEmitter->emit($response);
diff --git a/src/Application/Actions/Action.php b/src/Application/Actions/Action.php
new file mode 100644
index 0000000000000000000000000000000000000000..107d7c45e3349e0438bdc4c37362c9b22b381863
--- /dev/null
+++ b/src/Application/Actions/Action.php
@@ -0,0 +1,124 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Application\Actions;
+
+use App\Domain\DomainException\DomainRecordNotFoundException;
+use Psr\Http\Message\ResponseInterface as Response;
+use Psr\Http\Message\ServerRequestInterface as Request;
+use Psr\Log\LoggerInterface;
+use Slim\Exception\HttpBadRequestException;
+use Slim\Exception\HttpNotFoundException;
+
+abstract class Action
+{
+ /**
+ * @var LoggerInterface
+ */
+ protected $logger;
+
+ /**
+ * @var Request
+ */
+ protected $request;
+
+ /**
+ * @var Response
+ */
+ protected $response;
+
+ /**
+ * @var array
+ */
+ protected $args;
+
+ /**
+ * @param LoggerInterface $logger
+ */
+ public function __construct(LoggerInterface $logger)
+ {
+ $this->logger = $logger;
+ }
+
+ /**
+ * @param Request $request
+ * @param Response $response
+ * @param array $args
+ * @return Response
+ * @throws HttpNotFoundException
+ * @throws HttpBadRequestException
+ */
+ public function __invoke(Request $request, Response $response, $args): Response
+ {
+ $this->request = $request;
+ $this->response = $response;
+ $this->args = $args;
+
+ try {
+ return $this->action();
+ } catch (DomainRecordNotFoundException $e) {
+ throw new HttpNotFoundException($this->request, $e->getMessage());
+ }
+ }
+
+ /**
+ * @return Response
+ * @throws DomainRecordNotFoundException
+ * @throws HttpBadRequestException
+ */
+ abstract protected function action(): Response;
+
+ /**
+ * @return array|object
+ * @throws HttpBadRequestException
+ */
+ protected function getFormData()
+ {
+ $input = json_decode(file_get_contents('php://input'));
+
+ if (json_last_error() !== JSON_ERROR_NONE) {
+ throw new HttpBadRequestException($this->request, 'Malformed JSON input.');
+ }
+
+ return $input;
+ }
+
+ /**
+ * @param string $name
+ * @return mixed
+ * @throws HttpBadRequestException
+ */
+ protected function resolveArg(string $name)
+ {
+ if (!isset($this->args[$name])) {
+ throw new HttpBadRequestException($this->request, "Could not resolve argument `{$name}`.");
+ }
+
+ return $this->args[$name];
+ }
+
+ /**
+ * @param array|object|null $data
+ * @return Response
+ */
+ protected function respondWithData($data = null, int $statusCode = 200): Response
+ {
+ $payload = new ActionPayload($statusCode, $data);
+
+ return $this->respond($payload);
+ }
+
+ /**
+ * @param ActionPayload $payload
+ * @return Response
+ */
+ protected function respond(ActionPayload $payload): Response
+ {
+ $json = json_encode($payload, JSON_PRETTY_PRINT);
+ $this->response->getBody()->write($json);
+
+ return $this->response
+ ->withHeader('Content-Type', 'application/json')
+ ->withStatus($payload->getStatusCode());
+ }
+}
diff --git a/src/Application/Actions/ActionError.php b/src/Application/Actions/ActionError.php
new file mode 100644
index 0000000000000000000000000000000000000000..731b4ff94396c6190c3e2d24beac9de2a14b0a69
--- /dev/null
+++ b/src/Application/Actions/ActionError.php
@@ -0,0 +1,88 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Application\Actions;
+
+use JsonSerializable;
+
+class ActionError implements JsonSerializable
+{
+ public const BAD_REQUEST = 'BAD_REQUEST';
+ public const INSUFFICIENT_PRIVILEGES = 'INSUFFICIENT_PRIVILEGES';
+ public const NOT_ALLOWED = 'NOT_ALLOWED';
+ public const NOT_IMPLEMENTED = 'NOT_IMPLEMENTED';
+ public const RESOURCE_NOT_FOUND = 'RESOURCE_NOT_FOUND';
+ public const SERVER_ERROR = 'SERVER_ERROR';
+ public const UNAUTHENTICATED = 'UNAUTHENTICATED';
+ public const VALIDATION_ERROR = 'VALIDATION_ERROR';
+ public const VERIFICATION_ERROR = 'VERIFICATION_ERROR';
+
+ /**
+ * @var string
+ */
+ private $type;
+
+ /**
+ * @var string
+ */
+ private $description;
+
+ /**
+ * @param string $type
+ * @param string|null $description
+ */
+ public function __construct(string $type, ?string $description)
+ {
+ $this->type = $type;
+ $this->description = $description;
+ }
+
+ /**
+ * @return string
+ */
+ public function getType(): string
+ {
+ return $this->type;
+ }
+
+ /**
+ * @param string $type
+ * @return self
+ */
+ public function setType(string $type): self
+ {
+ $this->type = $type;
+ return $this;
+ }
+
+ /**
+ * @return string
+ */
+ public function getDescription(): string
+ {
+ return $this->description;
+ }
+
+ /**
+ * @param string|null $description
+ * @return self
+ */
+ public function setDescription(?string $description = null): self
+ {
+ $this->description = $description;
+ return $this;
+ }
+
+ /**
+ * @return array
+ */
+ public function jsonSerialize()
+ {
+ $payload = [
+ 'type' => $this->type,
+ 'description' => $this->description,
+ ];
+
+ return $payload;
+ }
+}
diff --git a/src/Application/Actions/ActionPayload.php b/src/Application/Actions/ActionPayload.php
new file mode 100644
index 0000000000000000000000000000000000000000..a5954e1676c02acdaf2d01f5544f1e6c35e14349
--- /dev/null
+++ b/src/Application/Actions/ActionPayload.php
@@ -0,0 +1,81 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Application\Actions;
+
+use JsonSerializable;
+
+class ActionPayload implements JsonSerializable
+{
+ /**
+ * @var int
+ */
+ private $statusCode;
+
+ /**
+ * @var array|object|null
+ */
+ private $data;
+
+ /**
+ * @var ActionError|null
+ */
+ private $error;
+
+ /**
+ * @param int $statusCode
+ * @param array|object|null $data
+ * @param ActionError|null $error
+ */
+ public function __construct(
+ int $statusCode = 200,
+ $data = null,
+ ?ActionError $error = null
+ ) {
+ $this->statusCode = $statusCode;
+ $this->data = $data;
+ $this->error = $error;
+ }
+
+ /**
+ * @return int
+ */
+ public function getStatusCode(): int
+ {
+ return $this->statusCode;
+ }
+
+ /**
+ * @return array|null|object
+ */
+ public function getData()
+ {
+ return $this->data;
+ }
+
+ /**
+ * @return ActionError|null
+ */
+ public function getError(): ?ActionError
+ {
+ return $this->error;
+ }
+
+ /**
+ * @return array
+ */
+ public function jsonSerialize()
+ {
+ $payload = [
+ 'statusCode' => $this->statusCode,
+ ];
+
+ if ($this->data !== null) {
+ $payload['data'] = $this->data;
+ } elseif ($this->error !== null) {
+ $payload['error'] = $this->error;
+ }
+
+ return $payload;
+ }
+}
diff --git a/src/Application/Actions/User/ListUsersAction.php b/src/Application/Actions/User/ListUsersAction.php
new file mode 100644
index 0000000000000000000000000000000000000000..21b47503f4024b8a24a5c47c5e5ca2be24ecf82c
--- /dev/null
+++ b/src/Application/Actions/User/ListUsersAction.php
@@ -0,0 +1,21 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Application\Actions\User;
+
+use Psr\Http\Message\ResponseInterface as Response;
+
+class ListUsersAction extends UserAction
+{
+ /**
+ * {@inheritdoc}
+ */
+ protected function action(): Response
+ {
+ $users = $this->userRepository->findAll();
+
+ $this->logger->info("Users list was viewed.");
+
+ return $this->respondWithData($users);
+ }
+}
diff --git a/src/Application/Actions/User/UserAction.php b/src/Application/Actions/User/UserAction.php
new file mode 100644
index 0000000000000000000000000000000000000000..45424833ec79ec19c86c04061fdc0f03c396f814
--- /dev/null
+++ b/src/Application/Actions/User/UserAction.php
@@ -0,0 +1,26 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Application\Actions\User;
+
+use App\Application\Actions\Action;
+use App\Domain\User\UserRepository;
+use Psr\Log\LoggerInterface;
+
+abstract class UserAction extends Action
+{
+ /**
+ * @var UserRepository
+ */
+ protected $userRepository;
+
+ /**
+ * @param LoggerInterface $logger
+ * @param UserRepository $userRepository
+ */
+ public function __construct(LoggerInterface $logger, UserRepository $userRepository)
+ {
+ parent::__construct($logger);
+ $this->userRepository = $userRepository;
+ }
+}
diff --git a/src/Application/Actions/User/ViewUserAction.php b/src/Application/Actions/User/ViewUserAction.php
new file mode 100644
index 0000000000000000000000000000000000000000..519d5fa1f7d4871bfbc046c624679e991a949060
--- /dev/null
+++ b/src/Application/Actions/User/ViewUserAction.php
@@ -0,0 +1,22 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Application\Actions\User;
+
+use Psr\Http\Message\ResponseInterface as Response;
+
+class ViewUserAction extends UserAction
+{
+ /**
+ * {@inheritdoc}
+ */
+ protected function action(): Response
+ {
+ $userId = (int) $this->resolveArg('id');
+ $user = $this->userRepository->findUserOfId($userId);
+
+ $this->logger->info("User of id `${userId}` was viewed.");
+
+ return $this->respondWithData($user);
+ }
+}
diff --git a/src/Application/Handlers/HttpErrorHandler.php b/src/Application/Handlers/HttpErrorHandler.php
new file mode 100644
index 0000000000000000000000000000000000000000..1fc31f67dc322b91d872a9ca6ab7d3fd12655dd5
--- /dev/null
+++ b/src/Application/Handlers/HttpErrorHandler.php
@@ -0,0 +1,69 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Application\Handlers;
+
+use App\Application\Actions\ActionError;
+use App\Application\Actions\ActionPayload;
+use Exception;
+use Psr\Http\Message\ResponseInterface as Response;
+use Slim\Exception\HttpBadRequestException;
+use Slim\Exception\HttpException;
+use Slim\Exception\HttpForbiddenException;
+use Slim\Exception\HttpMethodNotAllowedException;
+use Slim\Exception\HttpNotFoundException;
+use Slim\Exception\HttpNotImplementedException;
+use Slim\Exception\HttpUnauthorizedException;
+use Slim\Handlers\ErrorHandler as SlimErrorHandler;
+use Throwable;
+
+class HttpErrorHandler extends SlimErrorHandler
+{
+ /**
+ * @inheritdoc
+ */
+ protected function respond(): Response
+ {
+ $exception = $this->exception;
+ $statusCode = 500;
+ $error = new ActionError(
+ ActionError::SERVER_ERROR,
+ 'An internal error has occurred while processing your request.'
+ );
+
+ if ($exception instanceof HttpException) {
+ $statusCode = $exception->getCode();
+ $error->setDescription($exception->getMessage());
+
+ if ($exception instanceof HttpNotFoundException) {
+ $error->setType(ActionError::RESOURCE_NOT_FOUND);
+ } elseif ($exception instanceof HttpMethodNotAllowedException) {
+ $error->setType(ActionError::NOT_ALLOWED);
+ } elseif ($exception instanceof HttpUnauthorizedException) {
+ $error->setType(ActionError::UNAUTHENTICATED);
+ } elseif ($exception instanceof HttpForbiddenException) {
+ $error->setType(ActionError::INSUFFICIENT_PRIVILEGES);
+ } elseif ($exception instanceof HttpBadRequestException) {
+ $error->setType(ActionError::BAD_REQUEST);
+ } elseif ($exception instanceof HttpNotImplementedException) {
+ $error->setType(ActionError::NOT_IMPLEMENTED);
+ }
+ }
+
+ if (
+ !($exception instanceof HttpException)
+ && $exception instanceof Throwable
+ && $this->displayErrorDetails
+ ) {
+ $error->setDescription($exception->getMessage());
+ }
+
+ $payload = new ActionPayload($statusCode, null, $error);
+ $encodedPayload = json_encode($payload, JSON_PRETTY_PRINT);
+
+ $response = $this->responseFactory->createResponse($statusCode);
+ $response->getBody()->write($encodedPayload);
+
+ return $response->withHeader('Content-Type', 'application/json');
+ }
+}
diff --git a/src/Application/Handlers/ShutdownHandler.php b/src/Application/Handlers/ShutdownHandler.php
new file mode 100644
index 0000000000000000000000000000000000000000..9a593f7526e4e78b371e6742092701c08dff10ef
--- /dev/null
+++ b/src/Application/Handlers/ShutdownHandler.php
@@ -0,0 +1,83 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Application\Handlers;
+
+use App\Application\ResponseEmitter\ResponseEmitter;
+use Psr\Http\Message\ServerRequestInterface as Request;
+use Slim\Exception\HttpInternalServerErrorException;
+
+class ShutdownHandler
+{
+ /**
+ * @var Request
+ */
+ private $request;
+
+ /**
+ * @var HttpErrorHandler
+ */
+ private $errorHandler;
+
+ /**
+ * @var bool
+ */
+ private $displayErrorDetails;
+
+ /**
+ * ShutdownHandler constructor.
+ *
+ * @param Request $request
+ * @param HttpErrorHandler $errorHandler
+ * @param bool $displayErrorDetails
+ */
+ public function __construct(
+ Request $request,
+ HttpErrorHandler $errorHandler,
+ bool $displayErrorDetails
+ ) {
+ $this->request = $request;
+ $this->errorHandler = $errorHandler;
+ $this->displayErrorDetails = $displayErrorDetails;
+ }
+
+ public function __invoke()
+ {
+ $error = error_get_last();
+ if ($error) {
+ $errorFile = $error['file'];
+ $errorLine = $error['line'];
+ $errorMessage = $error['message'];
+ $errorType = $error['type'];
+ $message = 'An error while processing your request. Please try again later.';
+
+ if ($this->displayErrorDetails) {
+ switch ($errorType) {
+ case E_USER_ERROR:
+ $message = "FATAL ERROR: {$errorMessage}. ";
+ $message .= " on line {$errorLine} in file {$errorFile}.";
+ break;
+
+ case E_USER_WARNING:
+ $message = "WARNING: {$errorMessage}";
+ break;
+
+ case E_USER_NOTICE:
+ $message = "NOTICE: {$errorMessage}";
+ break;
+
+ default:
+ $message = "ERROR: {$errorMessage}";
+ $message .= " on line {$errorLine} in file {$errorFile}.";
+ break;
+ }
+ }
+
+ $exception = new HttpInternalServerErrorException($this->request, $message);
+ $response = $this->errorHandler->__invoke($this->request, $exception, $this->displayErrorDetails, false, false);
+
+ $responseEmitter = new ResponseEmitter();
+ $responseEmitter->emit($response);
+ }
+ }
+}
diff --git a/src/Application/Middleware/SessionMiddleware.php b/src/Application/Middleware/SessionMiddleware.php
new file mode 100644
index 0000000000000000000000000000000000000000..cbfc1d6ed17a13e78b60d6c9bdcb42f36fd01692
--- /dev/null
+++ b/src/Application/Middleware/SessionMiddleware.php
@@ -0,0 +1,25 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Application\Middleware;
+
+use Psr\Http\Message\ResponseInterface as Response;
+use Psr\Http\Message\ServerRequestInterface as Request;
+use Psr\Http\Server\MiddlewareInterface as Middleware;
+use Psr\Http\Server\RequestHandlerInterface as RequestHandler;
+
+class SessionMiddleware implements Middleware
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function process(Request $request, RequestHandler $handler): Response
+ {
+ if (isset($_SERVER['HTTP_AUTHORIZATION'])) {
+ session_start();
+ $request = $request->withAttribute('session', $_SESSION);
+ }
+
+ return $handler->handle($request);
+ }
+}
diff --git a/src/Application/ResponseEmitter/ResponseEmitter.php b/src/Application/ResponseEmitter/ResponseEmitter.php
new file mode 100644
index 0000000000000000000000000000000000000000..cebe4435f78c7f60403c47b3c82c6068a0fb420d
--- /dev/null
+++ b/src/Application/ResponseEmitter/ResponseEmitter.php
@@ -0,0 +1,34 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Application\ResponseEmitter;
+
+use Psr\Http\Message\ResponseInterface;
+use Slim\ResponseEmitter as SlimResponseEmitter;
+
+class ResponseEmitter extends SlimResponseEmitter
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function emit(ResponseInterface $response): void
+ {
+ // This variable should be set to the allowed host from which your API can be accessed with
+ $origin = isset($_SERVER['HTTP_ORIGIN']) ? $_SERVER['HTTP_ORIGIN'] : '';
+
+ $response = $response
+ ->withHeader('Access-Control-Allow-Credentials', 'true')
+ ->withHeader('Access-Control-Allow-Origin', $origin)
+ ->withHeader('Access-Control-Allow-Headers', 'X-Requested-With, Content-Type, Accept, Origin, Authorization')
+ ->withHeader('Access-Control-Allow-Methods', 'GET, POST, PUT, PATCH, DELETE, OPTIONS')
+ ->withHeader('Cache-Control', 'no-store, no-cache, must-revalidate, max-age=0')
+ ->withAddedHeader('Cache-Control', 'post-check=0, pre-check=0')
+ ->withHeader('Pragma', 'no-cache');
+
+ if (ob_get_contents()) {
+ ob_clean();
+ }
+
+ parent::emit($response);
+ }
+}
diff --git a/src/Domain/DomainException/DomainException.php b/src/Domain/DomainException/DomainException.php
new file mode 100644
index 0000000000000000000000000000000000000000..3ffe5528e14858f31d513523946d0a4e3d25377d
--- /dev/null
+++ b/src/Domain/DomainException/DomainException.php
@@ -0,0 +1,10 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Domain\DomainException;
+
+use Exception;
+
+abstract class DomainException extends Exception
+{
+}
diff --git a/src/Domain/DomainException/DomainRecordNotFoundException.php b/src/Domain/DomainException/DomainRecordNotFoundException.php
new file mode 100644
index 0000000000000000000000000000000000000000..229e10971e890632aa1783ee67d33e02e54bc830
--- /dev/null
+++ b/src/Domain/DomainException/DomainRecordNotFoundException.php
@@ -0,0 +1,8 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Domain\DomainException;
+
+class DomainRecordNotFoundException extends DomainException
+{
+}
diff --git a/src/Domain/User/User.php b/src/Domain/User/User.php
new file mode 100644
index 0000000000000000000000000000000000000000..553c3d377b777fcfeb9e5033014b3cd649621188
--- /dev/null
+++ b/src/Domain/User/User.php
@@ -0,0 +1,88 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Domain\User;
+
+use JsonSerializable;
+
+class User implements JsonSerializable
+{
+ /**
+ * @var int|null
+ */
+ private $id;
+
+ /**
+ * @var string
+ */
+ private $username;
+
+ /**
+ * @var string
+ */
+ private $firstName;
+
+ /**
+ * @var string
+ */
+ private $lastName;
+
+ /**
+ * @param int|null $id
+ * @param string $username
+ * @param string $firstName
+ * @param string $lastName
+ */
+ public function __construct(?int $id, string $username, string $firstName, string $lastName)
+ {
+ $this->id = $id;
+ $this->username = strtolower($username);
+ $this->firstName = ucfirst($firstName);
+ $this->lastName = ucfirst($lastName);
+ }
+
+ /**
+ * @return int|null
+ */
+ public function getId(): ?int
+ {
+ return $this->id;
+ }
+
+ /**
+ * @return string
+ */
+ public function getUsername(): string
+ {
+ return $this->username;
+ }
+
+ /**
+ * @return string
+ */
+ public function getFirstName(): string
+ {
+ return $this->firstName;
+ }
+
+ /**
+ * @return string
+ */
+ public function getLastName(): string
+ {
+ return $this->lastName;
+ }
+
+ /**
+ * @return array
+ */
+ public function jsonSerialize()
+ {
+ return [
+ 'id' => $this->id,
+ 'username' => $this->username,
+ 'firstName' => $this->firstName,
+ 'lastName' => $this->lastName,
+ ];
+ }
+}
diff --git a/src/Domain/User/UserNotFoundException.php b/src/Domain/User/UserNotFoundException.php
new file mode 100644
index 0000000000000000000000000000000000000000..2080774ab4fcda9a4ba8e9f8a705ca2ad1a6f3c2
--- /dev/null
+++ b/src/Domain/User/UserNotFoundException.php
@@ -0,0 +1,11 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Domain\User;
+
+use App\Domain\DomainException\DomainRecordNotFoundException;
+
+class UserNotFoundException extends DomainRecordNotFoundException
+{
+ public $message = 'The user you requested does not exist.';
+}
diff --git a/src/Domain/User/UserRepository.php b/src/Domain/User/UserRepository.php
new file mode 100644
index 0000000000000000000000000000000000000000..7085ebfa49b01619d676c02a62b594da7ca2be4c
--- /dev/null
+++ b/src/Domain/User/UserRepository.php
@@ -0,0 +1,19 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Domain\User;
+
+interface UserRepository
+{
+ /**
+ * @return User[]
+ */
+ public function findAll(): array;
+
+ /**
+ * @param int $id
+ * @return User
+ * @throws UserNotFoundException
+ */
+ public function findUserOfId(int $id): User;
+}
diff --git a/src/Infrastructure/Persistence/User/InMemoryUserRepository.php b/src/Infrastructure/Persistence/User/InMemoryUserRepository.php
new file mode 100644
index 0000000000000000000000000000000000000000..93cb77129c669b34e5ae789cc8c4fe58308d9997
--- /dev/null
+++ b/src/Infrastructure/Persistence/User/InMemoryUserRepository.php
@@ -0,0 +1,52 @@
+<?php
+declare(strict_types=1);
+
+namespace App\Infrastructure\Persistence\User;
+
+use App\Domain\User\User;
+use App\Domain\User\UserNotFoundException;
+use App\Domain\User\UserRepository;
+
+class InMemoryUserRepository implements UserRepository
+{
+ /**
+ * @var User[]
+ */
+ private $users;
+
+ /**
+ * InMemoryUserRepository constructor.
+ *
+ * @param array|null $users
+ */
+ public function __construct(array $users = null)
+ {
+ $this->users = $users ?? [
+ 1 => new User(1, 'bill.gates', 'Bill', 'Gates'),
+ 2 => new User(2, 'steve.jobs', 'Steve', 'Jobs'),
+ 3 => new User(3, 'mark.zuckerberg', 'Mark', 'Zuckerberg'),
+ 4 => new User(4, 'evan.spiegel', 'Evan', 'Spiegel'),
+ 5 => new User(5, 'jack.dorsey', 'Jack', 'Dorsey'),
+ ];
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function findAll(): array
+ {
+ return array_values($this->users);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function findUserOfId(int $id): User
+ {
+ if (!isset($this->users[$id])) {
+ throw new UserNotFoundException();
+ }
+
+ return $this->users[$id];
+ }
+}
diff --git a/tests/Application/Actions/ActionTest.php b/tests/Application/Actions/ActionTest.php
new file mode 100644
index 0000000000000000000000000000000000000000..69d41d22044f333420797c0ce1298abb14d83cbb
--- /dev/null
+++ b/tests/Application/Actions/ActionTest.php
@@ -0,0 +1,78 @@
+<?php
+declare(strict_types=1);
+
+namespace Tests\Application\Actions;
+
+use App\Application\Actions\Action;
+use App\Application\Actions\ActionPayload;
+use DateTimeImmutable;
+use Psr\Http\Message\ResponseInterface as Response;
+use Psr\Log\LoggerInterface;
+use Tests\TestCase;
+
+class ActionTest extends TestCase
+{
+ public function testActionSetsHttpCodeInRespond()
+ {
+ $app = $this->getAppInstance();
+ $container = $app->getContainer();
+ $logger = $container->get(LoggerInterface::class);
+
+ $testAction = new class($logger) extends Action {
+ public function __construct(
+ LoggerInterface $loggerInterface
+ ) {
+ parent::__construct($loggerInterface);
+ }
+
+ public function action() :Response
+ {
+ return $this->respond(
+ new ActionPayload(
+ 202,
+ [
+ 'willBeDoneAt' => (new DateTimeImmutable())->format(DateTimeImmutable::ATOM)
+ ]
+ )
+ );
+ }
+ };
+
+ $app->get('/test-action-response-code', $testAction);
+ $request = $this->createRequest('GET', '/test-action-response-code');
+ $response = $app->handle($request);
+
+ $this->assertEquals(202, $response->getStatusCode());
+ }
+
+ public function testActionSetsHttpCodeRespondData()
+ {
+ $app = $this->getAppInstance();
+ $container = $app->getContainer();
+ $logger = $container->get(LoggerInterface::class);
+
+ $testAction = new class($logger) extends Action {
+ public function __construct(
+ LoggerInterface $loggerInterface
+ ) {
+ parent::__construct($loggerInterface);
+ }
+
+ public function action() :Response
+ {
+ return $this->respondWithData(
+ [
+ 'willBeDoneAt' => (new DateTimeImmutable())->format(DateTimeImmutable::ATOM)
+ ],
+ 202
+ );
+ }
+ };
+
+ $app->get('/test-action-response-code', $testAction);
+ $request = $this->createRequest('GET', '/test-action-response-code');
+ $response = $app->handle($request);
+
+ $this->assertEquals(202, $response->getStatusCode());
+ }
+}
diff --git a/tests/Application/Actions/User/ListUserActionTest.php b/tests/Application/Actions/User/ListUserActionTest.php
new file mode 100644
index 0000000000000000000000000000000000000000..f2d79c8a9fad944d7f2c7876604730757cf01dda
--- /dev/null
+++ b/tests/Application/Actions/User/ListUserActionTest.php
@@ -0,0 +1,40 @@
+<?php
+declare(strict_types=1);
+
+namespace Tests\Application\Actions\User;
+
+use App\Application\Actions\ActionPayload;
+use App\Domain\User\UserRepository;
+use App\Domain\User\User;
+use DI\Container;
+use Tests\TestCase;
+
+class ListUserActionTest extends TestCase
+{
+ public function testAction()
+ {
+ $app = $this->getAppInstance();
+
+ /** @var Container $container */
+ $container = $app->getContainer();
+
+ $user = new User(1, 'bill.gates', 'Bill', 'Gates');
+
+ $userRepositoryProphecy = $this->prophesize(UserRepository::class);
+ $userRepositoryProphecy
+ ->findAll()
+ ->willReturn([$user])
+ ->shouldBeCalledOnce();
+
+ $container->set(UserRepository::class, $userRepositoryProphecy->reveal());
+
+ $request = $this->createRequest('GET', '/users');
+ $response = $app->handle($request);
+
+ $payload = (string) $response->getBody();
+ $expectedPayload = new ActionPayload(200, [$user]);
+ $serializedPayload = json_encode($expectedPayload, JSON_PRETTY_PRINT);
+
+ $this->assertEquals($serializedPayload, $payload);
+ }
+}
diff --git a/tests/Application/Actions/User/ViewUserActionTest.php b/tests/Application/Actions/User/ViewUserActionTest.php
new file mode 100644
index 0000000000000000000000000000000000000000..0b30cbc342e2959130c111d486c706359d5f9f68
--- /dev/null
+++ b/tests/Application/Actions/User/ViewUserActionTest.php
@@ -0,0 +1,79 @@
+<?php
+declare(strict_types=1);
+
+namespace Tests\Application\Actions\User;
+
+use App\Application\Actions\ActionError;
+use App\Application\Actions\ActionPayload;
+use App\Application\Handlers\HttpErrorHandler;
+use App\Domain\User\User;
+use App\Domain\User\UserNotFoundException;
+use App\Domain\User\UserRepository;
+use DI\Container;
+use Slim\Middleware\ErrorMiddleware;
+use Tests\TestCase;
+
+class ViewUserActionTest extends TestCase
+{
+ public function testAction()
+ {
+ $app = $this->getAppInstance();
+
+ /** @var Container $container */
+ $container = $app->getContainer();
+
+ $user = new User(1, 'bill.gates', 'Bill', 'Gates');
+
+ $userRepositoryProphecy = $this->prophesize(UserRepository::class);
+ $userRepositoryProphecy
+ ->findUserOfId(1)
+ ->willReturn($user)
+ ->shouldBeCalledOnce();
+
+ $container->set(UserRepository::class, $userRepositoryProphecy->reveal());
+
+ $request = $this->createRequest('GET', '/users/1');
+ $response = $app->handle($request);
+
+ $payload = (string) $response->getBody();
+ $expectedPayload = new ActionPayload(200, $user);
+ $serializedPayload = json_encode($expectedPayload, JSON_PRETTY_PRINT);
+
+ $this->assertEquals($serializedPayload, $payload);
+ }
+
+ public function testActionThrowsUserNotFoundException()
+ {
+ $app = $this->getAppInstance();
+
+ $callableResolver = $app->getCallableResolver();
+ $responseFactory = $app->getResponseFactory();
+
+ $errorHandler = new HttpErrorHandler($callableResolver, $responseFactory);
+ $errorMiddleware = new ErrorMiddleware($callableResolver, $responseFactory, true, false ,false);
+ $errorMiddleware->setDefaultErrorHandler($errorHandler);
+
+ $app->add($errorMiddleware);
+
+ /** @var Container $container */
+ $container = $app->getContainer();
+
+ $userRepositoryProphecy = $this->prophesize(UserRepository::class);
+ $userRepositoryProphecy
+ ->findUserOfId(1)
+ ->willThrow(new UserNotFoundException())
+ ->shouldBeCalledOnce();
+
+ $container->set(UserRepository::class, $userRepositoryProphecy->reveal());
+
+ $request = $this->createRequest('GET', '/users/1');
+ $response = $app->handle($request);
+
+ $payload = (string) $response->getBody();
+ $expectedError = new ActionError(ActionError::RESOURCE_NOT_FOUND, 'The user you requested does not exist.');
+ $expectedPayload = new ActionPayload(404, null, $expectedError);
+ $serializedPayload = json_encode($expectedPayload, JSON_PRETTY_PRINT);
+
+ $this->assertEquals($serializedPayload, $payload);
+ }
+}
diff --git a/tests/Domain/User/UserTest.php b/tests/Domain/User/UserTest.php
new file mode 100644
index 0000000000000000000000000000000000000000..03746b13218fa5c1c853122f4233ed758da97600
--- /dev/null
+++ b/tests/Domain/User/UserTest.php
@@ -0,0 +1,59 @@
+<?php
+declare(strict_types=1);
+
+namespace Tests\Domain\User;
+
+use App\Domain\User\User;
+use Tests\TestCase;
+
+class UserTest extends TestCase
+{
+ public function userProvider()
+ {
+ return [
+ [1, 'bill.gates', 'Bill', 'Gates'],
+ [2, 'steve.jobs', 'Steve', 'Jobs'],
+ [3, 'mark.zuckerberg', 'Mark', 'Zuckerberg'],
+ [4, 'evan.spiegel', 'Evan', 'Spiegel'],
+ [5, 'jack.dorsey', 'Jack', 'Dorsey'],
+ ];
+ }
+
+ /**
+ * @dataProvider userProvider
+ * @param int $id
+ * @param string $username
+ * @param string $firstName
+ * @param string $lastName
+ */
+ public function testGetters(int $id, string $username, string $firstName, string $lastName)
+ {
+ $user = new User($id, $username, $firstName, $lastName);
+
+ $this->assertEquals($id, $user->getId());
+ $this->assertEquals($username, $user->getUsername());
+ $this->assertEquals($firstName, $user->getFirstName());
+ $this->assertEquals($lastName, $user->getLastName());
+ }
+
+ /**
+ * @dataProvider userProvider
+ * @param int $id
+ * @param string $username
+ * @param string $firstName
+ * @param string $lastName
+ */
+ public function testJsonSerialize(int $id, string $username, string $firstName, string $lastName)
+ {
+ $user = new User($id, $username, $firstName, $lastName);
+
+ $expectedPayload = json_encode([
+ 'id' => $id,
+ 'username' => $username,
+ 'firstName' => $firstName,
+ 'lastName' => $lastName,
+ ]);
+
+ $this->assertEquals($expectedPayload, json_encode($user));
+ }
+}
diff --git a/tests/Infrastructure/Persistence/User/InMemoryUserRepositoryTest.php b/tests/Infrastructure/Persistence/User/InMemoryUserRepositoryTest.php
new file mode 100644
index 0000000000000000000000000000000000000000..f82af6d4d9171aa2f638aea780fd28f41dc858cf
--- /dev/null
+++ b/tests/Infrastructure/Persistence/User/InMemoryUserRepositoryTest.php
@@ -0,0 +1,52 @@
+<?php
+declare(strict_types=1);
+
+namespace Tests\Infrastructure\Persistence\User;
+
+use App\Domain\User\User;
+use App\Domain\User\UserNotFoundException;
+use App\Infrastructure\Persistence\User\InMemoryUserRepository;
+use Tests\TestCase;
+
+class InMemoryUserRepositoryTest extends TestCase
+{
+ public function testFindAll()
+ {
+ $user = new User(1, 'bill.gates', 'Bill', 'Gates');
+
+ $userRepository = new InMemoryUserRepository([1 => $user]);
+
+ $this->assertEquals([$user], $userRepository->findAll());
+ }
+
+ public function testFindAllUsersByDefault()
+ {
+ $users = [
+ 1 => new User(1, 'bill.gates', 'Bill', 'Gates'),
+ 2 => new User(2, 'steve.jobs', 'Steve', 'Jobs'),
+ 3 => new User(3, 'mark.zuckerberg', 'Mark', 'Zuckerberg'),
+ 4 => new User(4, 'evan.spiegel', 'Evan', 'Spiegel'),
+ 5 => new User(5, 'jack.dorsey', 'Jack', 'Dorsey'),
+ ];
+
+ $userRepository = new InMemoryUserRepository();
+
+ $this->assertEquals(array_values($users), $userRepository->findAll());
+ }
+
+ public function testFindUserOfId()
+ {
+ $user = new User(1, 'bill.gates', 'Bill', 'Gates');
+
+ $userRepository = new InMemoryUserRepository([1 => $user]);
+
+ $this->assertEquals($user, $userRepository->findUserOfId(1));
+ }
+
+ public function testFindUserOfIdThrowsNotFoundException()
+ {
+ $userRepository = new InMemoryUserRepository([]);
+ $this->expectException(UserNotFoundException::class);
+ $userRepository->findUserOfId(1);
+ }
+}
diff --git a/tests/TestCase.php b/tests/TestCase.php
new file mode 100644
index 0000000000000000000000000000000000000000..f677b3a62035679b0be01eb431c7d497e9ce33aa
--- /dev/null
+++ b/tests/TestCase.php
@@ -0,0 +1,86 @@
+<?php
+declare(strict_types=1);
+
+namespace Tests;
+
+use DI\ContainerBuilder;
+use Exception;
+use PHPUnit\Framework\TestCase as PHPUnit_TestCase;
+use Psr\Http\Message\ServerRequestInterface as Request;
+use Slim\App;
+use Slim\Factory\AppFactory;
+use Slim\Psr7\Factory\StreamFactory;
+use Slim\Psr7\Headers;
+use Slim\Psr7\Request as SlimRequest;
+use Slim\Psr7\Uri;
+
+class TestCase extends PHPUnit_TestCase
+{
+ /**
+ * @return App
+ * @throws Exception
+ */
+ protected function getAppInstance(): App
+ {
+ // Instantiate PHP-DI ContainerBuilder
+ $containerBuilder = new ContainerBuilder();
+
+ // Container intentionally not compiled for tests.
+
+ // Set up settings
+ $settings = require __DIR__ . '/../app/settings.php';
+ $settings($containerBuilder);
+
+ // Set up dependencies
+ $dependencies = require __DIR__ . '/../app/dependencies.php';
+ $dependencies($containerBuilder);
+
+ // Set up repositories
+ $repositories = require __DIR__ . '/../app/repositories.php';
+ $repositories($containerBuilder);
+
+ // Build PHP-DI Container instance
+ $container = $containerBuilder->build();
+
+ // Instantiate the app
+ AppFactory::setContainer($container);
+ $app = AppFactory::create();
+
+ // Register middleware
+ $middleware = require __DIR__ . '/../app/middleware.php';
+ $middleware($app);
+
+ // Register routes
+ $routes = require __DIR__ . '/../app/routes.php';
+ $routes($app);
+
+ return $app;
+ }
+
+ /**
+ * @param string $method
+ * @param string $path
+ * @param array $headers
+ * @param array $cookies
+ * @param array $serverParams
+ * @return Request
+ */
+ protected function createRequest(
+ string $method,
+ string $path,
+ array $headers = ['HTTP_ACCEPT' => 'application/json'],
+ array $cookies = [],
+ array $serverParams = []
+ ): Request {
+ $uri = new Uri('', '', 80, $path);
+ $handle = fopen('php://temp', 'w+');
+ $stream = (new StreamFactory())->createStreamFromResource($handle);
+
+ $h = new Headers();
+ foreach ($headers as $name => $value) {
+ $h->addHeader($name, $value);
+ }
+
+ return new SlimRequest($method, $uri, $h, $cookies, $serverParams, $stream);
+ }
+}
diff --git a/tests/bootstrap.php b/tests/bootstrap.php
new file mode 100644
index 0000000000000000000000000000000000000000..3de1bcda3ba4e84a77895202b90550f245688df9
--- /dev/null
+++ b/tests/bootstrap.php
@@ -0,0 +1,3 @@
+<?php
+require __DIR__ . '/../vendor/autoload.php';
+
diff --git a/var/cache/.gitignore b/var/cache/.gitignore
new file mode 100644
index 0000000000000000000000000000000000000000..d6b7ef32c8478a48c3994dcadc86837f4371184d
--- /dev/null
+++ b/var/cache/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore